CAS 526-43-2
:2-[2-(methylamino)benzoyl]-2,3,4,9-tetrahydro-1H-beta-carbolin-1-one
Description:
The chemical substance known as 2-[2-(methylamino)benzoyl]-2,3,4,9-tetrahydro-1H-beta-carbolin-1-one, with the CAS number 526-43-2, is a member of the beta-carboline family, which are known for their diverse biological activities. This compound features a beta-carboline core structure, characterized by a fused indole and pyridine ring system, which contributes to its potential pharmacological properties. The presence of a methylamino group and a benzoyl moiety enhances its reactivity and may influence its interaction with biological targets. Beta-carbolines are often studied for their roles in neurochemistry, including effects on neurotransmitter systems and potential applications in treating neurological disorders. Additionally, this compound may exhibit properties such as antioxidant activity and modulation of enzyme systems. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C19H17N3O2
InChI:InChI=1/C19H17N3O2/c1-20-15-8-4-3-7-14(15)18(23)22-11-10-13-12-6-2-5-9-16(12)21-17(13)19(22)24/h2-9,20-21H,10-11H2,1H3
SMILES:CNc1ccccc1C(=O)N1CCc2c3ccccc3[nH]c2C1=O
Synonyms:- 1H-Pyrido[3,4-b]indol-1-one, 2,3,4,9-tetrahydro-2-[2-(methylamino)benzoyl]-
- Rhetsinin
- 2,3,4,9-Tetrahydro-2-[2-(methylamino)benzoyl]-1H-pyrido[3,4-b]indol-1-one
- 2-[2-(Methylamino)benzoyl]-3,4-dihydro-β-carboline-1(2H)-one
- Rhetsinine
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-(2-(Methylamino)benzoyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-one
CAS:Controlled ProductFormula:C19H17N3O2Color and Shape:NeatMolecular weight:319.357Hydroxyevodiamine
CAS:<p>Hydroxyevodiamine is a bioactive compound, which is a natural derivative isolated from the plant Evodia rutaecarpa. The product is sourced from the traditional medicinal herb widely recognized for its diverse therapeutic properties. Its mode of action involves interacting with cellular receptors and enzymes, contributing to its potential as an anti-inflammatory and vasodilatory agent. Hydroxyevodiamine exhibits significant promise in biochemical and pharmacological research due to its potential effects on cardiovascular health and inflammation pathways. Scientists are interested in its therapeutic applications, including exploring its efficacy in managing cardiovascular conditions and inflammatory disorders. As research progresses, it continues to be a focal point for studies aimed at understanding the mechanistic pathways and therapeutic potential of naturally derived compounds.</p>Formula:C19H17N3O2Purity:Min. 95%Molecular weight:319.4 g/mol


