CAS 526-78-3: 2,3-Dibromosuccinic acid

Description:2,3-Dibromosuccinic acid is a dibromo derivative of succinic acid, characterized by the presence of two bromine atoms attached to the second and third carbon atoms of the succinic acid backbone. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols. It has a molecular formula of C4H4Br2O4 and a molecular weight that reflects the presence of the bromine substituents. The compound exhibits acidic properties due to the carboxylic acid functional groups, which can donate protons in solution. 2,3-Dibromosuccinic acid is of interest in organic synthesis and can serve as an intermediate in the preparation of various chemical compounds. Its reactivity is influenced by the electronegative bromine atoms, which can participate in nucleophilic substitution reactions. Additionally, it may have applications in medicinal chemistry and materials science, although specific uses can vary based on ongoing research and development. Safety precautions should be observed when handling this compound due to its potential toxicity and reactivity.

Formula:C₄H₄Br₂O₄

InChI:InChI=1S/C4H4Br2O4/c5-1(3(7)8)2(6)4(9)10/h1-2H,(H,7,8)(H,9,10)

InChI key:InChIKey=FJWGRXKOBIVTFA-UHFFFAOYSA-N

SMILES:O=C(O)C(Br)C(Br)C(=O)O

Synonyms:
(2R,3S)-2,3-dibromobutanedioate
(2R,3S)-2,3-dibromobutanedioic acid
2,3-Dibromo Dibutyric Acid
2,3-Dibromobutanedioic acid
2,3-Dibromosucinic Acid
Butanedioic acid, 2,3-dibromo-
Dibromosuccinicacid
NSC 119053
NSC 1904
Succinic acid, 2,3-dibromo-
See more synonyms
Succinic acid, α,β-dibromo-
meso-2,3-Dibromosuccinic acid
α,β-Dibromosuccinic acid

Found 3 products.

Product data	Purity	Price range	Estimated delivery
2,3-Dibromosuccinic acid REF: IN-DA003B3TCAS: 526-78-3	98%	27.00 €~134.00 €	Tue 15 Apr 25
2,3-Dibromosuccinic acid REF: 10-F002914CAS: 526-78-3	97.0%	To inquire	Fri 25 Apr 25
2,3-Dibromosuccinic acid REF: 3D-AAA52678CAS: 526-78-3	Min. 95%	To inquire	Tue 27 May 25