
CAS 526-84-1
:Dihydroxymaleic acid
Description:
Dihydroxymaleic acid, with the CAS number 526-84-1, is an organic compound that is a derivative of maleic acid, characterized by the presence of two hydroxyl (-OH) groups. This compound typically appears as a white crystalline solid and is soluble in water due to its polar hydroxyl groups. Dihydroxymaleic acid is known for its ability to participate in various chemical reactions, including esterification and polymerization, making it of interest in organic synthesis and materials science. Its structure allows for potential applications in the production of biodegradable polymers and as a building block in the synthesis of more complex organic molecules. Additionally, the presence of multiple functional groups can influence its reactivity and interactions with other chemical species. As with many organic acids, it may exhibit acidic properties, contributing to its behavior in different chemical environments. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C4H4O6
InChI:InChI=1S/C4H4O6/c5-1(3(7)8)2(6)4(9)10/h5-6H,(H,7,8)(H,9,10)/b2-1-
InChI key:InChIKey=BZCOSCNPHJNQBP-UPHRSURJSA-N
SMILES:C(=C(\C(O)=O)/O)(\C(O)=O)/O
Synonyms:- Dihydroxymaleic acid
- (2Z)-2,3-Dihydroxy-2-butenedioic acid
- Maleic acid, dihydroxy-
- 2-Butenedioic acid, 2,3-dihydroxy-, (2Z)-
- 2-Butenedioic acid, 2,3-dihydroxy-, (Z)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.