CAS 526-98-7
:2-keto-L-Gulonic acid
Description:
2-Keto-L-Gulonic acid, with the CAS number 526-98-7, is a naturally occurring organic compound that plays a significant role in the biosynthesis of ascorbic acid (vitamin C) in certain organisms. It is a keto acid, characterized by the presence of a ketone functional group and multiple hydroxyl groups, which contribute to its solubility in water and its reactivity. This compound is typically found in a crystalline form and is known for its stability under standard conditions. Its molecular structure includes a six-carbon backbone, with specific stereochemistry that classifies it as an L-isomer. 2-Keto-L-Gulonic acid is involved in various metabolic pathways and has potential applications in nutrition and pharmaceuticals, particularly in the synthesis of vitamin C derivatives. Additionally, it exhibits antioxidant properties, which may contribute to its biological significance. Overall, its unique structural features and biological relevance make it an interesting subject of study in both chemistry and biochemistry.
Formula:C6H10O7
InChI:InChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-4,7-10H,1H2,(H,12,13)/t2-,3+,4-/m0/s1
InChI key:InChIKey=VBUYCZFBVCCYFD-NUNKFHFFSA-N
SMILES:[C@H]([C@@H]([C@H](CO)O)O)(C(C(O)=O)=O)O
Synonyms:- (3S,4R,5S)-3,4,5,6-tetrahydroxy-2-oxohexanoate (non-preferred name)
- 2-Keto-<span class="text-smallcaps">L</span>-gulonic acid
- 2-Keto-<span class="text-smallcaps">L</span>-idonic acid
- 2-Keto-L-gulonic acid hydrate
- 2-Oxo-l-gulonic acid
- 3-keto-L-Gulonic acid
- <span class="text-smallcaps">L</span>-Xylohexulosonic acid
- <span class="text-smallcaps">L</span>-xylo-2-Hexulosonic acid
- <span class="text-smallcaps">L</span>-xylo-Hexulosonic acid
- D-tagatosonic acid
- Gulonic acid, 2-keto-, <span class="text-smallcaps">L</span>-
- Idonic acid, 2-keto-, <span class="text-smallcaps">L</span>-
- Idonic acid, 2-keto-, L-
- L-Xylohexulosonic acid
- L-sorbosonic acid
- L-xylo-2-Hexulosonic acid
- L-xylo-Hex-2-ulosonic acid
- L-xylo-Hexulosonic acid
- Gulonic acid, 2-keto-, L-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
L-xylo-hex-2-ulosonic acid
CAS:Formula:C6H10O7Purity:95%Color and Shape:SolidMolecular weight:194.1394(3S,4R,5S)-3,4,5,6-Tetrahydroxy-2-oxohexanoic acid
CAS:(3S,4R,5S)-3,4,5,6-Tetrahydroxy-2-oxohexanoic acidPurity:95%Molecular weight:194.14g/mol2-Keto-L-gulonic Acid
CAS:Controlled ProductStability Hygroscopic
Applications 2-Keto-L-gulonic Acid is used in biological studies for the formation of sorbitol metabolism by Acetobacter melanogenus.
References Okazaki, H., et al.: Agric. Biol. Chem., 33, 207 (1969)Formula:C6H10O7Color and Shape:NeatMolecular weight:194.14L-Xylo-hex-2-ulosonic acid
CAS:Please enquire for more information about L-Xylo-hex-2-ulosonic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C6H10O7Purity:Min. 95%Molecular weight:194.14 g/molRef: 4Z-A-129012
Discontinued product




