CAS 526-99-8: Mucic acid
Description:Mucic acid, also known as galactaric acid, is a dicarboxylic acid with the chemical formula C6H10O8. It is a white, crystalline solid that is soluble in water and exhibits a slightly sweet taste. Mucic acid is derived from the oxidation of sugars, particularly galactose, and is commonly found in certain plant materials. Its structure features two carboxylic acid groups (-COOH) attached to a six-carbon chain, which contributes to its acidity and reactivity. Mucic acid is used in various applications, including as a precursor in organic synthesis and in the production of certain pharmaceuticals. Additionally, it has potential uses in the food industry as a flavoring agent or preservative. The compound is generally considered safe, but like many organic acids, it should be handled with care to avoid irritation. Its CAS number, 526-99-8, is a unique identifier that facilitates the identification and regulation of this chemical in various contexts.
Formula:C6H10O8
InChI:InChI=1/C6H10O8/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-4,7-10H,(H,11,12)(H,13,14)/t1-,2+,3+,4-
InChI key:InChIKey=DSLZVSRJTYRBFB-DUHBMQHGNA-N
SMILES:O=C(O)C(O)C(O)C(O)C(O)C(=O)O
- Synonyms:
- (2R,3S,4R,5S)-2,3,4,5-tetrahydroxyhexanedioate (non-preferred name)
- (2S,3R,4R,5S)-2,3,4,5-tetrahydroxyhexanedioate (non-preferred name)
- (2S,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanedioate (non-preferred name)
- 2,2,3,3-Tetrahydroxyhexanedioic Acid
- D-galactaric acid
- Galactaric acid
- Galactaric acid~Tetrahydroxyadipic acid
- Galactosaccharic acid
- Hexaric Acid
- NSC 8127
- See more synonyms
- Saccharolactic acid
- galacto-Hexaric acid
- Mucic acid
