CAS 52601-05-5
:(2E)-1-[2,4-dihydroxy-3-(3-methylbut-2-en-1-yl)phenyl]-3-phenylprop-2-en-1-one
Description:
The chemical substance known as (2E)-1-[2,4-dihydroxy-3-(3-methylbut-2-en-1-yl)phenyl]-3-phenylprop-2-en-1-one, with the CAS number 52601-05-5, is a type of chalcone, which is characterized by its structure featuring a central α,β-unsaturated carbonyl group flanked by two aromatic rings. This compound exhibits notable antioxidant and anti-inflammatory properties, making it of interest in various biological and pharmacological studies. The presence of hydroxyl groups in its structure enhances its reactivity and potential for hydrogen bonding, contributing to its biological activity. Additionally, the compound's conjugated double bond system may provide it with UV-absorbing capabilities, which can be beneficial in cosmetic applications. Its unique structural features also suggest potential for further derivatization, allowing for the exploration of new derivatives with enhanced properties. Overall, this substance represents a significant area of interest in organic chemistry and medicinal research due to its diverse applications and biological significance.
Formula:C20H20O3
InChI:InChI=1/C20H20O3/c1-14(2)8-10-16-19(22)13-11-17(20(16)23)18(21)12-9-15-6-4-3-5-7-15/h3-9,11-13,22-23H,10H2,1-2H3/b12-9+
Synonyms:- (E)-1-(2,4-Dihydroxy-3-(3-methyl-2-butenyl)phenyl)-3-phenyl-2-propen-1-one
- 2-Propen-1-one, 1-(2,4-dihydroxy-3-(3-methyl-2-butenyl)phenyl)-3-phenyl-, (E)-
- 2-propen-1-one, 1-[2,4-dihydroxy-3-(3-methyl-2-buten-1-yl)phenyl]-3-phenyl-, (2E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Isocordoin
CAS:Isocordoin is a naturally derived isoflavonoid compound, which is extracted primarily from species within the Fabaceae family. Its mode of action involves the modulation of various cellular signaling pathways, particularly those involved in anti-inflammatory and antioxidant responses. Through the inhibition of specific enzymes and transcription factors, Isocordoin exhibits the potential to mediate cellular oxidative stress and inflammation, thereby promoting cellular homeostasis.
Formula:C20H20O3Purity:Min. 85 Area-%Color and Shape:PowderMolecular weight:308.37 g/mol
