CymitQuimica logo

CAS 52601-70-4

:

8-Methyl-1,2,3,4-tetrahydroquinoline

Description:
8-Methyl-1,2,3,4-tetrahydroquinoline is a bicyclic organic compound characterized by its fused ring structure, which includes a quinoline moiety. It features a methyl group at the 8-position of the tetrahydroquinoline framework, contributing to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its structural similarity to various biologically active compounds. The presence of the tetrahydroquinoline structure allows for diverse reactivity, including potential interactions with biological targets. Additionally, it may exhibit interesting properties such as fluorescence or specific solubility characteristics, which can be influenced by the methyl substitution. As with many organic compounds, safety and handling precautions are essential, as it may pose health risks if ingested or inhaled. Overall, 8-Methyl-1,2,3,4-tetrahydroquinoline is a compound of interest in both synthetic and medicinal chemistry.
Formula:C10H13N
InChI:InChI=1S/C10H13N/c1-8-4-2-5-9-6-3-7-11-10(8)9/h2,4-5,11H,3,6-7H2,1H3
InChI key:InChIKey=YIIPMCFBCZKCFB-UHFFFAOYSA-N
SMILES:CC1=C2C(=CC=C1)CCCN2
Synonyms:
  • 1,2,3,4-Tetrahydro-8-methylquinoline
  • Akos B016010
  • Akos Bb-9798
  • Art-Chem-Bb B016010
  • Quinoline, 1,2,3,4-tetrahydro-8-methyl-
  • 8-Methyl-1,2,3,4-tetrahydroquinoline
Found 5 products.