CAS 52606-08-3

6-Bromo-2,3-dimethoxypyridine

Description:

6-Bromo-2,3-dimethoxypyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with bromine and methoxy groups. The molecular structure features a bromine atom at the 6-position and two methoxy groups at the 2 and 3 positions of the pyridine ring, which contribute to its chemical reactivity and physical properties. This compound typically appears as a solid or liquid, depending on the specific conditions, and is soluble in organic solvents. Its unique structure allows it to participate in various chemical reactions, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. The presence of the bromine atom can enhance electrophilic reactivity, while the methoxy groups can influence the compound's polarity and solubility. Additionally, 6-Bromo-2,3-dimethoxypyridine may exhibit biological activity, which can be explored in medicinal chemistry contexts. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₇H₈BrNO₂

InChI: InChI=1S/C7H8BrNO2/c1-10-5-3-4-6(8)9-7(5)11-2/h3-4H,1-2H3

InChI key: InChIKey=KUEBOEUQASVFTR-UHFFFAOYSA-N

SMILES: O(C)C1=C(OC)N=C(Br)C=C1

Synonyms:

• Pyridine, 2-bromo-5,6-dimethoxy-
• 6-Bromo-2,3-dimethoxypyridine
• Pyridine, 6-bromo-2,3-dimethoxy-

6-Bromo-2,3-dimethoxypyridine

CAS: 52606-08-3

Versatile small molecule scaffold

Formula: C₇H₈BrNO₂

Purity: Min. 95%

Molecular weight: 218.05 g/mol

Ref: 3D-CCA60608