CAS 5261-23-4

3,3',3'',3'''-(ethane-1,2-diyldinitrilo)tetrapropan-1-ol

Description:

3,3',3'',3'''-(ethane-1,2-diyldinitrilo)tetrapropan-1-ol, with the CAS number 5261-23-4, is a complex organic compound characterized by its multiple functional groups. It features a tetravalent alcohol structure, indicating the presence of four hydroxyl (-OH) groups, which contribute to its solubility in polar solvents and its potential as a ligand in coordination chemistry. The compound also contains nitrile groups (-C≡N), which can participate in various chemical reactions, including nucleophilic additions and coordination with metal ions. Its molecular structure suggests it may exhibit chelating properties, making it useful in applications such as metal ion extraction or as a reagent in organic synthesis. The presence of both alcohol and nitrile functionalities may also influence its reactivity and interaction with biological systems. Overall, this compound's unique structure and functional groups make it of interest in both synthetic and applied chemistry contexts.

Formula: C₁₄H₃₂N₂O₄

InChI: InChI=1/C14H32N2O4/c17-11-1-5-15(6-2-12-18)9-10-16(7-3-13-19)8-4-14-20/h17-20H,1-14H2

SMILES: C(CN(CCCO)CCN(CCCO)CCCO)CO

N,N,N',N'-Tetra(3-hydroxypropyl)ethylene diamine

CAS: 5261-23-4

Formula: C₁₄H₃₂N₂O₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 292.4149

Ref: IN-DA00DJHU

N,N,N',N'-Tetra(3-hydroxypropyl)ethylene diamine

CAS: 5261-23-4

N,N,N',N'-Tetra(3-hydroxypropyl)ethylene diamine

Purity: 97%

Molecular weight: 292.41g/mol

Ref: 54-OR1042990