CymitQuimica logo

CAS 5261-50-7

:

1-Chloromethyl-4-methylnaphthalene

Description:
1-Chloromethyl-4-methylnaphthalene, with the CAS number 5261-50-7, is an organic compound that belongs to the class of naphthalene derivatives. It features a naphthalene backbone substituted with a chloromethyl group and a methyl group, which influences its chemical properties and reactivity. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its aromatic characteristics, which contribute to its potential applications in organic synthesis and as an intermediate in the production of various chemicals. The presence of the chloromethyl group makes it a reactive species, capable of participating in nucleophilic substitution reactions. Additionally, 1-chloromethyl-4-methylnaphthalene may exhibit moderate toxicity and should be handled with care, following appropriate safety protocols. Its solubility in organic solvents and limited solubility in water are typical for such aromatic compounds, making it useful in various chemical processes and applications in the field of organic chemistry.
Formula:C19H23FN2
InChI:InChI=1/C19H23FN2/c1-15-3-4-17(16(2)13-15)14-21-9-11-22(12-10-21)19-7-5-18(20)6-8-19/h3-8,13H,9-12,14H2,1-2H3
SMILES:Cc1ccc(CN2CCN(CC2)c2ccc(cc2)F)c(C)c1
Synonyms:
  • 1-(2,4-Dimethylbenzyl)-4-(4-Fluorophenyl)Piperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.