CAS 52611-75-3

(2S,3R)-2,3-Dihydro-3-hydroxy-6-(2-hydroxyethyl)-2-(hydroxymethyl)-2,5,7-trimethyl-1H-inden-1-one

Description:

The chemical substance known as (2S,3R)-2,3-Dihydro-3-hydroxy-6-(2-hydroxyethyl)-2-(hydroxymethyl)-2,5,7-trimethyl-1H-inden-1-one, with the CAS number 52611-75-3, is a complex organic compound characterized by its unique stereochemistry and functional groups. It features multiple hydroxyl (-OH) groups, which contribute to its hydrophilicity and potential reactivity in various chemical environments. The presence of the indene structure provides a fused ring system that can influence its electronic properties and stability. This compound may exhibit biological activity due to its structural features, making it of interest in fields such as medicinal chemistry and biochemistry. Its trimethyl groups suggest potential lipophilicity, which can affect its solubility and interaction with biological membranes. Overall, the compound's intricate structure and functional groups suggest a range of possible applications and interactions in chemical and biological systems.

Formula: C₁₅H₂₀O₄

InChI: InChI=1S/C15H20O4/c1-8-6-11-12(9(2)10(8)4-5-16)14(19)15(3,7-17)13(11)18/h6,13,16-18H,4-5,7H2,1-3H3/t13-,15+/m1/s1

InChI key: InChIKey=OOAFRMHKOSBPID-HIFRSBDPSA-N

SMILES: O[C@@H]1C=2C(C(=O)[C@]1(CO)C)=C(C)C(CCO)=C(C)C2

Synonyms:

• (2S,3R)-2,3-Dihydro-3-hydroxy-6-(2-hydroxyethyl)-2-(hydroxymethyl)-2,5,7-trimethyl-1H-inden-1-one
• Epipterosin L
• 1H-Inden-1-one, 2,3-dihydro-3-hydroxy-6-(2-hydroxyethyl)-2-(hydroxymethyl)-2,5,7-trimethyl-, (2S,3R)-
• 1H-Inden-1-one, 2,3-dihydro-3-hydroxy-6-(2-hydroxyethyl)-2-(hydroxymethyl)-2,5,7-trimethyl-, (2S-trans)-

Epipterosin L

CAS: 52611-75-3

Epipterosin L is a natural product of Cibotium, Dicksoniaceae.

Formula: C₁₅H₂₀O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 264.32

Ref: TM-TN3976

Epipterosin L

CAS: 52611-75-3

Formula: C₁₅H₂₀O₄

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 264.321

Ref: BP-SBP02113

Epipterosin L

CAS: 52611-75-3

Epipterosin L is a glycoside compound, which is a natural product isolated from specific plant species known for their medicinal properties. This compound is typically derived from regions with rich biodiversity where such plants are endemic. The mode of action of Epipterosin L involves interacting with cellular mechanisms that can alter biochemical pathways, potentially offering therapeutic effects. Additionally, it could modulate enzyme activities or receptor interactions based on its unique structure, suggesting potential as a pharmacologically active agent.

Formula: C₁₅H₂₀O₄

Purity: Min. 95%

Molecular weight: 264.32 g/mol

Ref: 3D-CCA61175