CAS 5264-40-4
:4-(trichloromethyl)benzoic acid
Description:
4-(Trichloromethyl)benzoic acid, with the CAS number 5264-40-4, is an aromatic carboxylic acid characterized by the presence of a benzoic acid structure substituted with a trichloromethyl group at the para position. This compound typically appears as a white to off-white crystalline solid. It is known for its relatively low solubility in water but can dissolve in organic solvents such as ethanol and acetone. The presence of the trichloromethyl group imparts significant reactivity, making it useful in various chemical syntheses, particularly in the production of agrochemicals and pharmaceuticals. The compound exhibits moderate toxicity and should be handled with care, following appropriate safety protocols. Its chemical properties include the ability to undergo typical reactions of carboxylic acids, such as esterification and acid-base reactions. Additionally, it may participate in electrophilic aromatic substitution due to the electron-withdrawing nature of the trichloromethyl group, influencing its reactivity and applications in organic synthesis.
Formula:C8H5Cl3O2
InChI:InChI=1/C8H5Cl3O2/c9-8(10,11)6-3-1-5(2-4-6)7(12)13/h1-4H,(H,12,13)
SMILES:c1cc(ccc1C(=O)O)C(Cl)(Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

