CAS 52648-13-2
:3-(2-aminoethyl)-5-methoxy-1H-indole-2-carboxylic acid
Description:
3-(2-aminoethyl)-5-methoxy-1H-indole-2-carboxylic acid, also known by its CAS number 52648-13-2, is a chemical compound that features an indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This substance contains an aminoethyl side chain and a methoxy group, contributing to its unique properties. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions, making it a potential candidate for various biochemical applications. The methoxy group can influence the compound's solubility and reactivity, while the aminoethyl group may enhance its interaction with biological systems, possibly affecting its pharmacological activity. This compound is of interest in medicinal chemistry and may be studied for its potential roles in neurotransmitter systems or as a precursor in the synthesis of other bioactive molecules. Its specific characteristics, such as solubility, stability, and reactivity, would depend on the conditions under which it is studied.
Formula:C12H14N2O3
InChI:InChI=1/C12H14N2O3/c1-17-7-2-3-10-9(6-7)8(4-5-13)11(14-10)12(15)16/h2-3,6,14H,4-5,13H2,1H3,(H,15,16)
SMILES:COc1ccc2c(c1)c(CCN)c(C(=O)O)[nH]2
Synonyms:- 1H-indole-2-carboxylic acid, 3-(2-aminoethyl)-5-methoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-(2-Aminoethyl)-5-methoxy-1H-indole-2-carboxylic acid
CAS:3-(2-Aminoethyl)-5-methoxy-1H-indole-2-carboxylic acidPurity:95%Molecular weight:234.26g/mol3-(2-Aminoethyl)-5-methoxy-1H-indole-2-carboxylic acid
CAS:3-(2-Aminoethyl)-5-methoxy-1H-indole-2-carboxylic acid is a fine chemical that is used as a building block for research chemicals, reagents, and specialty chemicals. It has the CAS No. 52648-13-2. 3-(2-Aminoethyl)-5-methoxy-1H-indole-2-carboxylic acid is also a versatile building block for synthesis of complex compounds with high quality and is a reaction component in many reactions. This compound can serve as an intermediate or scaffold in chemical synthesis.Formula:C12H14N2O3Purity:Min. 95%Color and Shape:White PowderMolecular weight:234.25 g/mol


