CAS 52659-56-0
:Kirenol
Description:
Kirenol, with the CAS number 52659-56-0, is a chemical compound that belongs to the class of natural products known as terpenoids. It is primarily derived from the plant species of the genus *Kira*, which contributes to its classification. Kirenol is characterized by its unique molecular structure, which includes multiple functional groups that contribute to its biological activity. This compound has garnered interest in the field of medicinal chemistry due to its potential anti-inflammatory and antioxidant properties. Additionally, Kirenol has been studied for its effects on various cellular pathways, suggesting possible therapeutic applications. Its solubility and stability can vary depending on the solvent and environmental conditions, which is important for its practical use in formulations. As with many natural compounds, further research is necessary to fully understand its mechanisms of action and potential benefits in health and disease management. Overall, Kirenol represents a promising area of study within phytochemistry and pharmacology.
Formula:C20H34O4
InChI:InChI=1/C20H34O4/c1-18(17(24)11-21)7-6-15-13(8-18)4-5-16-19(2,12-22)9-14(23)10-20(15,16)3/h8,14-17,21-24H,4-7,9-12H2,1-3H3/t14-,15-,16-,17+,18+,19+,20+/m1/s1
InChI key:InChIKey=NRYNTARIOIRWAB-JPDRSCFKSA-N
SMILES:C[C@]12[C@]3(C(=C[C@]([C@H](CO)O)(C)CC3)CC[C@@]1([C@@](CO)(C)C[C@@H](O)C2)[H])[H]
Synonyms:- 1,7-Phenanthrenedimethanol, 1,2,3,4,4a,4b,5,6,7,9,10,10a-dodecahydro-3-hydroxy-α7-(hydroxymethyl)-1,4a,7-trimethyl-, (α7R,1R,3S,4aS,4bR,7S,10aS)-
- (α7R,1R,3S,4aS,4bR,7S,10aS)-1,2,3,4,4a,4b,5,6,7,9,10,10a-Dodecahydro-3-hydroxy-α7-(hydroxymethyl)-1,4a,7-trimethyl-1,7-phenanthrenedimethanol
- 1,7-Phenanthrenedimethanol, 1,2,3,4,4a,4b,5,6,7,9,10,10a-dodecahydro-3-hydroxy-α7-(hydroxymethyl)-1,4a,7-trimethyl-, [1R-[1α,3β,4aα,4bβ,7α(R*),10aβ]]-
- Kirenol
- (1R,3S,4aS,4bS,7S,10aS)-1,2,3,4,4a,4b,5,6,7,9,10,10a-Dodecahydro-3-hydroxy-7-[(R)-1,2-dihydroxyethyl]-1,4a,7-trimethylphenanthrene-1-methanol
- KIRENOL(P)
- Kirel
- (1R)-1-[(2S,4aR,4bS,6S,8R,8aS)-6-hydroxy-8-(hydroxymethyl)-2,4b,8-trimethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-yl]ethane-1,2-diol
- 1,7-PhenanthrenediMethanol,1,2,3,4,4a,4b,5,6,7,- 9,10,10a-dodecahydro-3-hydroxy-R7- (hydroxyMethyl)-1,4a,7-triMethyl-,(R7R,1R,- 3S,4aS,4bR,7S,10aS)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 12 products.
Kirenol
CAS:Kirenol analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C20H34O4Purity:(HPLC) ≥96%Color and Shape:PowderMolecular weight:338.49(R)-1-((2S,4aR,4bS,6S,8R,8aS)-6-Hydroxy-8-(hydroxymethyl)-2,4b,8-trimethyl-2,3,4,4a,4b,5,6,7,8,8a,9,10-dodecahydrophenanthren-2-yl)ethane-1,2-diol
CAS:Formula:C20H34O4Purity:95%Color and Shape:SolidMolecular weight:338.4816Kirenol
CAS:Formula:C20H34O4Purity:≥ 95.0%Color and Shape:Off-white to grey solid or powderMolecular weight:338.49Kirenol
CAS:Formula:C20H34O4Purity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:338.49Kirenol
CAS:Kirenol possesses anti-bacteria, immunosuppression, anti-obesity, anti-oxidant, anti-inflammatory, anti-allergic, and anti-arthritic activities. Kirenol has significant potential for its discovery as a new lead compound for management of topical pain and inflammation; it can upregulate nuclear Annexin-1 which interacts with NF-κB to attenuate synovial inflammation of collagen-induced arthritis in rats. Kirenol can attenuate experimental autoimmune encephalomyelitis by inhibiting differentiation of Th1 and th17 cells and inducing apoptosis of effector T cells. Kirenol activates the BMP and Wnt/β-catenin signaling pathways.Formula:C20H34O4Purity:95%~99%Molecular weight:338.488Kirenol
CAS:Kirenol fights inflammation, allergies, arthritis, bacteria, cancer cells, promotes bone growth, and regulates immune response.Formula:C20H34O4Purity:99.6% - 99.87%Color and Shape:SolidMolecular weight:338.48Kirenol
CAS:Cyclic alcoholFormula:C20H34O4Purity:≥ 98.0 % (HPLC)Color and Shape:PowderMolecular weight:338.49Kirenol
CAS:Controlled Product<p>Kirenol is a naturally occurring bioactive compound, which is derived from the plant Herba Siegesbeckiae. This compound is a diterpenoid, extracted primarily from the herb Siegesbeckia orientalis, a plant known for its traditional medicinal uses in various cultures. Kirenol exhibits its mode of action by modulating inflammatory pathways, specifically inhibiting pro-inflammatory cytokines and enzymes. This inhibitory effect helps in reducing inflammation, making it a focal point of interest in anti-inflammatory research.</p>Formula:C20H34O4Purity:Min. 95%Color and Shape:PowderMolecular weight:338.48 g/mol











