CAS 52659-56-0: Kirenol
Description:Kirenol, with the CAS number 52659-56-0, is a chemical compound that belongs to the class of natural products known as terpenoids. It is primarily derived from the plant species of the genus *Kira*, which contributes to its classification. Kirenol is characterized by its unique molecular structure, which includes multiple functional groups that contribute to its biological activity. This compound has garnered interest in the field of medicinal chemistry due to its potential anti-inflammatory and antioxidant properties. Additionally, Kirenol has been studied for its effects on various cellular pathways, suggesting possible therapeutic applications. Its solubility and stability can vary depending on the solvent and environmental conditions, which is important for its practical use in formulations. As with many natural compounds, further research is necessary to fully understand its mechanisms of action and potential benefits in health and disease management. Overall, Kirenol represents a promising area of study within phytochemistry and pharmacology.
Formula:C20H34O4
InChI:InChI=1S/C20H34O4/c1-18(17(24)11-21)7-6-15-13(8-18)4-5-16-19(2,12-22)9-14(23)10-20(15,16)3/h8,14-17,21-24H,4-7,9-12H2,1-3H3/t14-,15-,16-,17+,18+,19+,20+/m1/s1
InChI key:InChIKey=NRYNTARIOIRWAB-JPDRSCFKSA-N
SMILES:OCC(O)C1(C=C2CCC3C(C)(CO)CC(O)CC3(C)C2CC1)C
- Synonyms:
- 1,7-Phenanthrenedimethanol, 1,2,3,4,4a,4b,5,6,7,9,10,10a-dodecahydro-3-hydroxy-α7-(hydroxymethyl)-1,4a,7-trimethyl-, (α7R,1R,3S,4aS,4bR,7S,10aS)-
- (α7R,1R,3S,4aS,4bR,7S,10aS)-1,2,3,4,4a,4b,5,6,7,9,10,10a-Dodecahydro-3-hydroxy-α7-(hydroxymethyl)-1,4a,7-trimethyl-1,7-phenanthrenedimethanol
- 1,7-Phenanthrenedimethanol, 1,2,3,4,4a,4b,5,6,7,9,10,10a-dodecahydro-3-hydroxy-α7-(hydroxymethyl)-1,4a,7-trimethyl-, [1R-[1α,3β,4aα,4bβ,7α(R*),10aβ]]-
- Kirenol
