CAS 5266-60-4

ethyl N-{[(diethoxyphosphorothioyl)sulfanyl]acetyl}isovalinate

Description:

Ethyl N-{[(diethoxyphosphorothioyl)sulfanyl]acetyl}isovalinate, with CAS number 5266-60-4, is a chemical compound that belongs to the class of organophosphorus compounds. It features a phosphorothioate functional group, which is characterized by the presence of phosphorus, sulfur, and oxygen atoms. This compound typically exhibits properties associated with organophosphates, such as potential biological activity and reactivity due to the presence of the phosphorothioate moiety. It may act as a pesticide or herbicide, given its structural characteristics that suggest potential interactions with biological systems. The ethyl and isovalinate groups contribute to its solubility and stability in various solvents. Additionally, the presence of the diethoxyphosphorothioyl group indicates that it may have applications in agricultural chemistry or as a biochemical agent. Safety and handling precautions are essential due to the potential toxicity associated with organophosphorus compounds, necessitating careful management in laboratory and industrial settings.

Formula: C₁₃H₂₆NO₅PS₂

InChI: InChI=1/C13H26NO5PS2/c1-6-13(5,12(16)17-7-2)14-11(15)10-22-20(21,18-8-3)19-9-4/h6-10H2,1-5H3,(H,14,15)

SMILES: CCC(C)(C(=O)OCC)N=C(CSP(=S)(OCC)OCC)O

5-Cyclopropylpentanoic acid

CAS: 5266-60-4

Purity: 95.0%

Molecular weight: 142.197998046875

Ref: 10-F547056