CAS 52662-00-7

Cyclo(-Gly-Gln)

Description:

Cyclo(-Gly-Gln), also known as cyclo-glycyl-glutamine, is a cyclic dipeptide composed of the amino acids glycine (Gly) and glutamine (Gln). This compound features a unique cyclic structure that can influence its biochemical properties and interactions. Cyclo(-Gly-Gln) is characterized by its potential to exhibit various biological activities, including antioxidant properties and the ability to modulate cellular signaling pathways. The cyclic nature of the molecule can enhance its stability compared to linear peptides, potentially improving its bioavailability and efficacy in biological systems. Additionally, the presence of the amide bond in the cyclic structure may contribute to its resistance to enzymatic degradation. Cyclo(-Gly-Gln) has garnered interest in pharmaceutical and nutraceutical research due to its potential therapeutic applications, although further studies are necessary to fully elucidate its mechanisms of action and potential benefits in health and disease. As with many peptides, its solubility, stability, and interaction with biological targets are critical factors influencing its utility in various applications.

Formula: C₇H₁₁N₃O₃

InChI: InChI=1/C7H11N3O3/c8-5(11)2-1-4-7(13)9-3-6(12)10-4/h4H,1-3H2,(H2,8,11)(H,9,13)(H,10,12)/t4-/m1/s1

SMILES: C(CC(=N)O)[C@@H]1C(=NCC(=N1)O)O

Cyclo(-Gln-Gly)

CAS: 52662-00-7

As its linear analog, N-1070, cyclo(Gly-Gln) is a biologically active peptide. The diketopiperazine is capable of reversing the cardiorespiratory depression produced by β-endorphin or morphine.

Formula: C₇H₁₁N₃O₃

Purity: > 99%

Color and Shape: White Powder

Molecular weight: 185.18

Ref: 01-4014279

(2S)-Hexahydro-3,6-dioxo-pyrazinepropanamide

CAS: 52662-00-7

Formula: C₇H₁₁N₃O₃

Purity: %

Color and Shape: Solid

Molecular weight: 185.1805

Ref: IN-DA0037Q6

Cyclo(Gly-L-Gln)

CAS: 52662-00-7

Cyclo(Gly-L-Gln) is an endogenous compound related to the cyclic peptide family, which includes neuropeptides such as β-endorphin. Cyclo(Gly-L-Gln) has been found to increase intracerebroventricular (i.c.v.) levels of β-endorphin and dopamine in rats, leading to a depression recovery response. The molecule has dose-dependent effects on the opioid receptor, with low doses acting as an agonist and high doses acting as an antagonist. This drug is also not polar and has a conformation that is similar to nicotine, which may explain its addictive properties and ability to induce dependence.

Formula: C₇H₁₁N₃O₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 185.18 g/mol

Ref: 3D-FC49426

(S)-3-(3,6-Dioxopiperazin-2-yl)propanamide

CAS: 52662-00-7

Formula: C₇H₁₁N₃O₃

Purity: 99%;RG

Molecular weight: 185.183

Ref: 10-F463129