CAS 52662-10-9
:4,6-dimethyl-3-(beta-D-ribofuranosyl)-3,4-dihydro-9H-imidazo[1,2-a]purin-9-one
Description:
4,6-Dimethyl-3-(beta-D-ribofuranosyl)-3,4-dihydro-9H-imidazo[1,2-a]purin-9-one, with the CAS number 52662-10-9, is a purine derivative that exhibits structural features characteristic of nucleosides. This compound contains a ribofuranosyl moiety, which is a sugar component that plays a crucial role in the structure of nucleic acids. The imidazo[1,2-a]purine core is notable for its involvement in various biological processes, including those related to nucleic acid metabolism. The presence of methyl groups at the 4 and 6 positions contributes to its stability and may influence its biological activity. This compound is of interest in medicinal chemistry and biochemistry due to its potential roles in cellular processes and as a precursor in the synthesis of other biologically relevant molecules. Its solubility, reactivity, and interaction with biological targets can vary based on the specific conditions and environments in which it is studied. Overall, this compound represents a significant structure in the field of nucleoside chemistry.
Formula:C14H17N5O5
InChI:InChI=1/C14H17N5O5/c1-6-3-18-12(23)8-11(17(2)14(18)16-6)19(5-15-8)13-10(22)9(21)7(4-20)24-13/h3,5,7,9-10,13,20-22H,4H2,1-2H3/t7-,9-,10-,13-/m1/s1
SMILES:Cc1cn2c(=O)c3c(n(C)c2n1)n(cn3)[C@H]1[C@@H]([C@@H]([C@@H](CO)O1)O)O
Synonyms:- 9H-Imidazo(1,2-a)purin-9-one, 3,4-dihydro-4,6-dimethyl-3-beta-D-ribofuranosyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-((2R,3R,4S,5R)-3,4-Dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-4,6-dimethyl-3,4-dihydro-9H-imidazo[1,2-a]purin-9-one
CAS:Controlled ProductFormula:C14H17N5O5Color and Shape:NeatMolecular weight:335.315Wyosine
CAS:Wyosine is a glycosylated protein that is found in the mitochondria of eukaryotic cells. It has been shown to have an acidic pH and to be non-covalently bound to a molecule with a molecular weight of approximately 2,000 Da. Wyosine binds to the wild-type strain of the bacterium Mycobacterium tuberculosis, which may play a role in its biological properties. This molecule also reacts with antibodies and can be used as an antigen for antibody production. Wyosine is structurally similar to x-ray crystal structures and has been observed by X-ray crystallography at atomic resolution.Formula:C14H17N5O5Purity:Min. 95%Molecular weight:335.32 g/mol


