CAS 52663-73-7
:2,2',3,3',4,5,6,6'-octachlorobiphenyl
Description:
2,2',3,3',4,5,6,6'-octachlorobiphenyl, commonly referred to as OC-8, is a synthetic organic compound belonging to the class of polychlorinated biphenyls (PCBs). It is characterized by its biphenyl structure, where eight chlorine atoms are substituted at various positions on the biphenyl rings, resulting in a highly chlorinated compound. This configuration contributes to its hydrophobic nature and stability, making it resistant to degradation in the environment. OC-8 is typically a colorless to light yellow solid and has low volatility. Due to its chemical stability, it has been used in various industrial applications, including as a dielectric fluid in capacitors and transformers. However, like other PCBs, it is recognized for its environmental persistence and potential toxicity, leading to bioaccumulation in the food chain and adverse health effects in humans and wildlife. Regulatory measures have been implemented in many countries to limit its use and manage its environmental impact.
Formula:C12H2Cl8
InChI:InChI=1/C12H2Cl8/c13-3-1-2-4(14)7(15)5(3)6-8(16)10(18)12(20)11(19)9(6)17/h1-2H
SMILES:c1cc(c(c(c1Cl)c1c(c(c(c(c1Cl)Cl)Cl)Cl)Cl)Cl)Cl
Synonyms:- 1,1'-Biphenyl, 2,2',3,3',4,5,6,6'-Octachloro-
- 2,2',3,3',4,5,6,6'-Octachloro-1,1'-biphenyl
- 2,2',3,3',4,5,6,6'-Pcb
- 52663-73-7
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
PCB No. 200 10 µg/mL in Isooctane
CAS:Controlled ProductFormula:C12H2Cl8Color and Shape:Single SolutionMolecular weight:429.77
