CAS 52663-75-9
:PCB 199
Description:
PCB 199, or polychlorinated biphenyl 199, is a member of the polychlorinated biphenyl (PCB) family, which consists of synthetic organic chemicals known for their environmental persistence and potential toxicity. Characterized by a biphenyl structure with multiple chlorine atoms substituted at various positions, PCB 199 typically contains a specific arrangement of chlorine atoms that influences its physical and chemical properties. It is a colorless to light yellow liquid with low volatility and high stability, making it resistant to degradation. PCBs, including PCB 199, are hydrophobic, leading to bioaccumulation in the food chain and posing risks to human health and the environment. They are known to disrupt endocrine functions and have been associated with various adverse health effects, including cancer. Due to these concerns, PCBs have been banned or heavily regulated in many countries. PCB 199, like other PCBs, is subject to environmental monitoring and remediation efforts to mitigate its impact on ecosystems and human health.
Formula:C12H2Cl8
InChI:InChI=1S/C12H2Cl8/c13-4-1-3(8(16)12(20)11(4)19)7-9(17)5(14)2-6(15)10(7)18/h1-2H
InChI key:InChIKey=HJBYDWKNARZTMJ-UHFFFAOYSA-N
SMILES:ClC1=C(C(Cl)=C(Cl)C=C1Cl)C2=C(Cl)C(Cl)=C(Cl)C(Cl)=C2
Synonyms:- 1,1'-Biphenyl, 2,2',3,3',4,5,5',6'-Octachloro-
- 1,1′-Biphenyl, 2,2′,3,3′,4,5,5′,6′-octachloro-
- 2,2',3,3',4',5,5',6-Octachlorobiphenyl
- 2,2',3,3',4,5,5',6'-Octachloro-1,1'-biphenyl
- 2,2',3,3',4,5,5',6'-Pcb
- 2,2′,3,3′,4,5,5′,6′-Octachloro-1,1′-biphenyl
- 2,2′,3,3′,4,5,5′,6′-Octachlorobiphenyl
- 2,3,4,5,2′,3′,5′,6′-Octachlorobiphenyl
- 2,3,5,6,2′,3′,4′,5′-Octachlorobiphenyl
- 52663-75-9
- Pcb 199
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
PCB No. 199 10 µg/mL in Isooctane
CAS:Controlled ProductFormula:C12H2Cl8Color and Shape:Single SolutionMolecular weight:429.772,2',3,3',4,5,5',6'-Octachlorobiphenyl
CAS:Controlled ProductFormula:C12H2Cl8Color and Shape:NeatMolecular weight:429.772,2',3,3',4,5,5',6'-Octachlorobiphenyl
CAS:Controlled Product2,2',3,3',4,5,5',6'-Octachlorobiphenyl is a polychlorinated biphenyl that has been shown to be spectroscopically and chromatographically similar to 2,2',3,4',5-pentachlorobiphenyl. Octachlorobiphenyl contains eight chlorine atoms in its structure, whereas pentachlorobiphenyl has six chlorines. The main difference between the two compounds is that octachlorobiphenyl is an isomer of pentachlorobiphenyl and it has a lower molecular weight. Octachlorobiphenyl can be found in the environment as an environmental pollutant or byproducts of combustion and industrial processes such as metal production and petroleum refining. It can also be formed during the production of other chlorinated organics such as chlorinated phenols or certain pesticides.
Formula:C12H2Cl8Purity:Min. 95%Molecular weight:429.8 g/molRef: 3D-CCA66375
Discontinued product


