CymitQuimica logo

CAS 5267-87-8

:

1-(piperidin-2-yl)ethane-1,2-diol

Description:
1-(Piperidin-2-yl)ethane-1,2-diol, with the CAS number 5267-87-8, is an organic compound characterized by the presence of a piperidine ring and two hydroxyl (-OH) groups attached to an ethane backbone. This compound typically exhibits properties associated with both amines and alcohols, such as solubility in polar solvents due to its hydroxyl groups, which can engage in hydrogen bonding. The piperidine moiety contributes to its basicity and potential reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. The presence of the two hydroxyl groups can also enhance its reactivity in condensation reactions or as a chiral building block in synthesis. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry. Its physical properties, such as melting point and boiling point, would depend on the specific molecular interactions and the presence of functional groups. Overall, 1-(piperidin-2-yl)ethane-1,2-diol is a versatile compound with potential applications in pharmaceuticals and organic synthesis.
Formula:C7H15NO2
InChI:InChI=1/C7H15NO2/c9-5-7(10)6-3-1-2-4-8-6/h6-10H,1-5H2
SMILES:C1CCNC(C1)C(CO)O
Synonyms:
  • 1,2-Ethanediol, 1- (2-piperidinyl)-
  • 1-(Piperidin-2-yl)ethane-1,2-diol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.