CAS 527-75-3
:Erythromycin B
Description:
Erythromycin B is a macrolide antibiotic that is primarily derived from the bacterium Saccharopolyspora erythraea. It is characterized by its large lactone ring structure, which is essential for its antibacterial activity. Erythromycin B exhibits a broad spectrum of activity against various Gram-positive bacteria and some Gram-negative bacteria, making it effective in treating respiratory tract infections, skin infections, and certain sexually transmitted diseases. The compound works by inhibiting bacterial protein synthesis through binding to the 50S ribosomal subunit, thereby preventing the growth and reproduction of bacteria. Erythromycin B is known for its relatively low toxicity and is often used as an alternative for patients allergic to penicillin. However, it can cause gastrointestinal side effects and may interact with other medications due to its effect on liver enzymes. Its stability is influenced by pH and temperature, and it is typically administered in the form of tablets or as a topical ointment. Overall, Erythromycin B remains an important antibiotic in clinical use, particularly in treating infections caused by susceptible organisms.
Formula:C37H67NO12
InChI:InChI=1S/C37H67NO12/c1-14-26-20(4)29(40)21(5)28(39)18(2)16-36(9,44)33(50-35-30(41)25(38(11)12)15-19(3)46-35)22(6)31(23(7)34(43)48-26)49-27-17-37(10,45-13)32(42)24(8)47-27/h18-27,29-33,35,40-42,44H,14-17H2,1-13H3/t18-,19-,20+,21+,22+,23-,24+,25+,26-,27+,29+,30-,31+,32+,33-,35+,36-,37-/m1/s1
InChI key:InChIKey=IDRYSCOQVVUBIJ-PPGFLMPOSA-N
SMILES:O([C@@H]1[C@@H](C)[C@H](O[C@H]2C[C@](OC)(C)[C@@H](O)[C@H](C)O2)[C@@H](C)C(=O)O[C@H](CC)[C@H](C)[C@H](O)[C@@H](C)C(=O)[C@H](C)C[C@@]1(C)O)[C@H]3[C@H](O)[C@@H](N(C)C)C[C@@H](C)O3
Synonyms:- (3R,4S,5S,6R,7R,9R,11S,12S,13R,14S)-6-{[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyltetrahydro-2H-pyran-2-yl]oxy}-14-ethyl-7,12-dihydroxy-4-{[(2R,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyltetrahydro-2H-pyran-2-yl]oxy}-3,5,7,9,11,13-hexamethyloxacyclotetradecane-2,10-dione (non-preferred name)
- (3R,4S,6R,7R,9R,11R,12S,13R,14R)-6-{[4-(dimethylamino)-3-hydroxy-6-methyltetrahydro-2H-pyran-2-yl]oxy}-14-ethyl-7,12-dihydroxy-4-[(5-hydroxy-4-methoxy-4,6-dimethyltetrahydro-2H-pyran-2-yl)oxy]-3,5,7,9,11,13-hexamethyloxacyclotetradecane-2,10-dione (non-preferred name)
- 12-Deoxyerythromycin
- Abbot 24091
- Abbott 24091
- Beritromicina
- Beritromicina [INN-Spanish]
- Berythromycin [USAN:INN]
- Berythromycine
- Berythromycine [INN-French]
- Berythromycinum
- Berythromycinum [INN-Latin]
- Brn 5206722
- Erythromycin B
- Erythromycin, 12-deoxy-
- Oxacyclotetradecane, erythromycin deriv.
- Berythromycin
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
Erythromycin B
CAS:Erythromycin and its derivatives; salts thereofFormula:C37H67NO12Color and Shape:White PowderMolecular weight:717.46633ERYTHROMYCIN B (150 MG)
CAS:Formula:C37H67NO12Purity:90%Color and Shape:SolidMolecular weight:717.9274Erythromycin B (~90%)
CAS:Controlled ProductApplications Erythromycin B is a co-metabolite of Erythromycin A (E649950), an antibacterial agent.
References Minh, N. et al.: Int. Food. Res. J., 18, 95 (2011); Koch, W.L. et al.: Anal. Profiles Drug Subs., 8, 157 (1979);Formula:C37H67NO12Purity:~90%Color and Shape:NeatMolecular weight:717.93Erythromycin B
CAS:Erythromycin B is a semisynthetic macrolide antibiotic, which is derived from the actinomycete *Saccharopolyspora erythraea*. Its mode of action involves inhibiting bacterial protein synthesis by binding to the 50S ribosomal subunit. This interference with protein synthesis effectively hampers bacterial growth, making it a potent bacteriostatic agent.Formula:C37H67NO12Purity:90%NmrMolecular weight:717.93 g/molErythromycin B
CAS:Erythromycin B exhibits antimalarial activity by effectively inhibiting the asexual growth of Plasmodium falciparum.Formula:C37H67NO12Color and Shape:SolidMolecular weight:717.93Erythromycin B
CAS:Erythromycin BFormula:C37H67NO12Purity:98.7%Color and Shape:WhiteMolecular weight:717.46633









