CAS 527-93-5
:2,4,7,9-tetrachloro-3-hydroxy-8-methoxy-1,6-dimethyl-11H-dibenzo[b,e][1,4]dioxepin-11-one
Description:
2,4,7,9-Tetrachloro-3-hydroxy-8-methoxy-1,6-dimethyl-11H-dibenzo[b,e][1,4]dioxepin-11-one, with CAS number 527-93-5, is a synthetic organic compound characterized by its complex polycyclic structure, which includes multiple aromatic rings and functional groups. This compound features a dibenzo[dioxepin] core, which contributes to its stability and potential biological activity. The presence of chlorine atoms and a methoxy group enhances its chemical reactivity and solubility properties, while the hydroxyl group may impart hydrogen-bonding capabilities, influencing its interactions in biological systems. The compound is of interest in various fields, including medicinal chemistry and environmental science, due to its potential applications and effects. Its chlorinated structure suggests possible uses in agrochemicals or as a synthetic intermediate, but it may also raise concerns regarding toxicity and environmental persistence. Overall, the unique arrangement of substituents on the dibenzo structure makes it a subject of study for its chemical behavior and potential applications.
Formula:C16H10Cl4O5
InChI:InChI=1/C16H10Cl4O5/c1-4-6-13(9(19)11(21)7(4)17)24-12-5(2)8(18)14(23-3)10(20)15(12)25-16(6)22/h21H,1-3H3
SMILES:Cc1c2c(c(c(c1Cl)O)Cl)Oc1c(C)c(c(c(c1OC2=O)Cl)OC)Cl
Synonyms:- 11H-dibenzo[b,e][1,4]dioxepin-11-one, 2,4,7,9-tetrachloro-3-hydroxy-8-methoxy-1,6-dimethyl-
- 3,5-Dichloro-6-[(3,5-dichloro-6-hydroxy-4-methoxy-o-tolyl)oxy]-4,2-cresotic Acid e-Lactone
- 5,6'-Dimethyl-2',3-dihydroxy-4'-methoxy-2,3',4,5'-tetrachloro-6-carboxydiphenyl Ether 2',6-Lactone
- 527-93-5
- 2,4,7,9-Tetrachloro-3-hydroxy-8-methoxy-1,6-dimethyl-11H-dibenzo[b,e]-[1,4]dioxepin-11-one
- 2,4,7,9-Tetrachloro-3-hydroxy-8-methoxy-1,6-dimethyl-11H-dibenzo[b,e][1,4]dioxepin-11-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Diploicin
CAS:Diploicin is a potent anticancer drug that inhibits the growth of human tumors by targeting kinases. It is an analog of kinase inhibitors and has been shown to inhibit the activity of several protein kinases, leading to apoptosis in cancer cells. Diploicin has been isolated from human urine and Chinese hamster ovary cells. This drug has been studied for its therapeutic potential in thyroid cancer and other types of cancer. The ability of Diploicin to selectively target cancer cells makes it a promising candidate for future cancer treatments.Formula:C16H10Cl4O5Purity:Min. 95%Molecular weight:424.1 g/molDiploicin
CAS:<p>Diploicin is a dibenzofuran lactone compound with activity against Gram-positive bacteria, found in lichens (lichens).</p>Formula:C16H10Cl4O5Color and Shape:SolidMolecular weight:424.06

