CymitQuimica logo

CAS 5271-28-3

:

1-Methyl-2-phenylpiperazine

Description:
1-Methyl-2-phenylpiperazine is an organic compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a methyl group at the 1-position and a phenyl group at the 2-position of the piperazine ring, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the phenyl group enhances its lipophilicity, making it more soluble in organic solvents than in water. 1-Methyl-2-phenylpiperazine is known for its potential biological activity, often studied in the context of pharmacology and medicinal chemistry, particularly for its interactions with various neurotransmitter receptors. It may exhibit psychoactive effects and has been investigated for its potential use in treating neurological disorders. As with many piperazine derivatives, safety and handling precautions are essential due to possible toxicity and regulatory considerations associated with its use.
Formula:C11H16N2
InChI:InChI=1S/C11H16N2/c1-13-8-7-12-9-11(13)10-5-3-2-4-6-10/h2-6,11-12H,7-9H2,1H3
InChI key:InChIKey=FUGQHVIDCRUGMP-UHFFFAOYSA-N
SMILES:CN1C(C2=CC=CC=C2)CNCC1
Synonyms:
  • Piperazine, 1-methyl-2-phenyl-
  • 1-Methyl-2-Phenylpiperazine
Found 3 products.