CAS 52711-92-9
:(2,5-dimethoxyphenyl)acetyl chloride
Description:
(2,5-Dimethoxyphenyl)acetyl chloride is an organic compound characterized by its acetyl chloride functional group attached to a dimethoxy-substituted phenyl ring. This compound typically appears as a colorless to pale yellow liquid with a pungent odor, indicative of the presence of the acyl chloride functional group. It is known for its reactivity, particularly in acylation reactions, where it can introduce the acetyl group into various substrates. The presence of the methoxy groups on the phenyl ring enhances its electron-donating properties, which can influence its reactivity and the stability of intermediates formed during chemical reactions. (2,5-Dimethoxyphenyl)acetyl chloride is soluble in organic solvents such as dichloromethane and ether but is generally less soluble in water due to its hydrophobic aromatic structure. As with many acyl chlorides, it is sensitive to moisture and can hydrolyze to form the corresponding carboxylic acid. Proper handling and storage in a dry environment are essential to maintain its stability and reactivity.
Formula:C10H11ClO3
InChI:InChI=1/C10H11ClO3/c1-13-8-3-4-9(14-2)7(5-8)6-10(11)12/h3-5H,6H2,1-2H3
SMILES:COc1ccc(c(c1)CC(=O)Cl)OC
Synonyms:- o-Homoveratryl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
