CAS 52715-93-2
:Methionylmethionine
Description:
Methionylmethionine, with the CAS number 52715-93-2, is a dipeptide composed of two methionine amino acids linked by a peptide bond. It is characterized by its sulfur-containing side chains, which contribute to its unique properties, including its role in protein synthesis and metabolism. Methionine is an essential amino acid, meaning it must be obtained through diet, and it plays a crucial role in various biological processes, including methylation reactions and as a precursor to other important biomolecules. Methionylmethionine may exhibit antioxidant properties due to the presence of sulfur, which can help in scavenging free radicals. In terms of solubility, it is generally soluble in water, which is typical for many peptides. Its stability can be influenced by factors such as pH and temperature. This compound may have applications in nutritional supplements and research related to protein structure and function, as well as potential therapeutic uses in various health-related fields.
Formula:C10H20N2O3S2
InChI:InChI=1S/C10H20N2O3S2/c1-16-5-3-7(11)9(13)12-8(10(14)15)4-6-17-2/h7-8H,3-6,11H2,1-2H3,(H,12,13)(H,14,15)
InChI key:InChIKey=ZYTPOUNUXRBYGW-UHFFFAOYSA-N
SMILES:C(NC(C(CCSC)N)=O)(CCSC)C(O)=O
Synonyms:- (2S)-2-{[(2S)-2-ammonio-4-(methylsulfanyl)butanoyl]amino}-4-(methylsulfanyl)butanoate
- <span class="text-smallcaps">DL</smallcap>-Methionine, N-<smallcap>DL</span>-methionyl-
- <span class="text-smallcaps">DL</smallcap>-Methionyl-<smallcap>DL</span>-methionine
- Methionine, methionyl-
- Methionylmethionine
- DL-Methionine, N-DL-methionyl-
- DL-Methionyl-DL-methionine
- N-DL-Methionyl-DL-methionine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Methionylmethionine HCl (Mixture of Diastereomers)
CAS:Formula:C10H20N2O3S2·HClColor and Shape:White To Off-White SolidMolecular weight:280.41 36.46DL-Methionyl-DL-methionine
CAS:Controlled ProductFormula:C10H20N2O3S2Color and Shape:NeatMolecular weight:280.4

