CAS 52722-86-8: 4-Hydroxy-2,2,6,6-tetramethyl-1-piperidineethanol
Description:4-Hydroxy-2,2,6,6-tetramethyl-1-piperidineethanol, with the CAS number 52722-86-8, is a chemical compound characterized by its piperidine structure, which includes a hydroxyl group and multiple methyl substituents. This compound is known for its antioxidant properties, making it useful in various applications, particularly in stabilizing polymers and preventing oxidative degradation. The presence of the hydroxyl group enhances its solubility in polar solvents, while the bulky tetramethyl groups contribute to its steric hindrance, influencing its reactivity and interactions with other molecules. Additionally, the compound exhibits a relatively stable structure, which is beneficial for its use in industrial applications. Its unique combination of functional groups allows it to act as a radical scavenger, effectively neutralizing free radicals and thus protecting materials from oxidative stress. Overall, 4-Hydroxy-2,2,6,6-tetramethyl-1-piperidineethanol is valued for its chemical stability and efficacy as an antioxidant in various formulations.
Formula:C11H23NO2
InChI:InChI=1S/C11H23NO2/c1-10(2)7-9(14)8-11(3,4)12(10)5-6-13/h9,13-14H,5-8H2,1-4H3
InChI key:InChIKey=STEYNUVPFMIUOY-UHFFFAOYSA-N
SMILES:OCCN1C(C)(C)CC(O)CC1(C)C
- Synonyms:
- 1-(2-Hydroxyethyl)-2,2,6,6-Tetramethyl-4-Piperidinol
- 1-(2-Hydroxyethyl)-2,2,6,6-Tetramethylpiperidin-4-Ol
- 1-(2-Hydroxyethyl)-2,2,6,6-tetramethyl-4-hydroxypiperidine
- 1-Piperidineethanol, 4-hydroxy-2,2,6,6-tetramethyl-
- 4-Hydroxy-1-(2-hydroxyethyl)-2,2,6,6-tetramethylpiperidine
- 4-Hydroxy-2,2,6,6-tetramethyl-1-piperidineethanol
- Antioxidant 201
- C 10-2625
- Hydroxyethyl tetramethylpiperidinol
- Light stabilizer 201
- See more synonyms
- N-2-Hydroxyethyl-4-hydroxy-2,2,6,6-tetramethylpiperidine
- N-Hydroxyethyl-TAA-ol
