CAS 52729-03-0
:2,4-Dichloro-3,5-dinitrobenzoic acid
Description:
2,4-Dichloro-3,5-dinitrobenzoic acid is an aromatic compound characterized by the presence of two chlorine atoms and two nitro groups attached to a benzoic acid structure. It is a yellow crystalline solid that is sparingly soluble in water but more soluble in organic solvents such as acetone and ethanol. The compound exhibits strong acidic properties due to the carboxylic acid functional group, which can donate protons in solution. Its molecular structure contributes to its reactivity, making it useful in various chemical syntheses and applications, particularly in the field of agrochemicals as a herbicide. The presence of multiple electronegative substituents enhances its electrophilic character, allowing it to participate in further chemical reactions. Additionally, 2,4-Dichloro-3,5-dinitrobenzoic acid is subject to environmental regulations due to its potential toxicity and persistence in the environment. Proper handling and disposal are essential to mitigate any ecological risks associated with its use.
Formula:C7H2Cl2N2O6
InChI:InChI=1S/C7H2Cl2N2O6/c8-4-2(7(12)13)1-3(10(14)15)5(9)6(4)11(16)17/h1H,(H,12,13)
InChI key:InChIKey=OCJYCLPVZHBZRL-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(Cl)C(C(O)=O)=CC(N(=O)=O)=C1Cl
Synonyms:- 2,4-Dichloro-3,5-Dinitrobenzoate
- Benzoic acid, 2,4-dichloro-3,5-dinitro-
- NSC 76602
- 2,4-Dichloro-3,5-dinitrobenzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
