CymitQuimica logo

CAS 5273-61-0

:

5,6-dibromocyclohex-2-ene-1,4-dione

Description:
5,6-Dibromocyclohex-2-ene-1,4-dione is an organic compound characterized by its unique bicyclic structure, which features a cyclohexene ring with two bromine substituents and two carbonyl groups. The presence of the double bond in the cyclohexene ring contributes to its reactivity, while the carbonyl groups (ketones) enhance its electrophilic character. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and specific conditions. It is soluble in organic solvents, such as dichloromethane and acetone, but has limited solubility in water due to its hydrophobic nature. The bromine atoms introduce significant polarizability and can influence the compound's reactivity in various chemical reactions, including electrophilic aromatic substitution and nucleophilic addition. Additionally, 5,6-dibromocyclohex-2-ene-1,4-dione may have applications in organic synthesis and materials science, particularly in the development of dyes or pharmaceuticals. As with many brominated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns.
Formula:C6H4Br2O2
InChI:InChI=1/C6H4Br2O2/c7-5-3(9)1-2-4(10)6(5)8/h1-2,5-6H
SMILES:C1=CC(=O)C(C(C1=O)Br)Br
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.