CAS 52737-49-2
:N-(1H-imidazol-2-yl)acetamide
Description:
N-(1H-imidazol-2-yl)acetamide, with the CAS number 52737-49-2, is an organic compound characterized by its imidazole ring and acetamide functional group. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of both hydrophilic amide and imidazole groups. It exhibits properties that make it of interest in various fields, including medicinal chemistry, where it may serve as a building block for pharmaceuticals or as a ligand in coordination chemistry. The imidazole moiety contributes to its potential biological activity, including antimicrobial and antifungal properties. Additionally, the compound may participate in hydrogen bonding due to the amide group, influencing its reactivity and interactions with other molecules. Overall, N-(1H-imidazol-2-yl)acetamide is a versatile compound with potential applications in drug development and biochemical research.
Formula:C5H7N3O
InChI:InChI=1/C5H7N3O/c1-4(9)8-5-6-2-3-7-5/h2-3H,1H3,(H2,6,7,8,9)
SMILES:CC(=Nc1ncc[nH]1)O
Synonyms:- acetamide, N-1H-imidazol-2-yl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
