CymitQuimica logo

CAS 5274-71-5

:

2-Bromo-4-nitrobenzaldehyde

Description:
2-Bromo-4-nitrobenzaldehyde is an organic compound characterized by its aromatic structure, featuring both a bromine atom and a nitro group attached to a benzaldehyde moiety. Its molecular formula is C7H4BrN2O3, indicating the presence of seven carbon atoms, four hydrogen atoms, one bromine atom, two nitrogen atoms, and three oxygen atoms. This compound typically appears as a yellow to orange crystalline solid and is known for its reactivity due to the presence of the electrophilic bromine and nitro groups, which can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. It is often used in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, 2-Bromo-4-nitrobenzaldehyde exhibits properties such as solubility in organic solvents and moderate stability under standard conditions, although it should be handled with care due to its potential toxicity and environmental impact. Proper safety measures should be taken when working with this compound in laboratory settings.
Formula:C16H17BrN2O3S
InChI:InChI=1/C16H17BrN2O3S/c1-3-5-11-14(16(20)21-4-2)13(10(7-18)15(19)22-11)12-6-9(17)8-23-12/h6,8,13H,3-5,19H2,1-2H3
InChI key:XKDLLBUNDADXAA-UHFFFAOYSA-N
SMILES:CCCC1=C(C(C(=C(N)O1)C#N)c1cc(cs1)Br)C(=O)OCC
Found 4 products.