
CAS 52742-40-2
:γ-Methoxy-γ-phenyl-N-2-propen-1-ylbenzenepropanamine
Description:
γ-Methoxy-γ-phenyl-N-2-propen-1-ylbenzenepropanamine, with the CAS number 52742-40-2, is a chemical compound that belongs to the class of substituted amines. This substance features a complex structure characterized by a methoxy group, a phenyl group, and a propenyl side chain, which contribute to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific formulation. The presence of the methoxy group enhances its solubility in organic solvents, while the phenyl and propenyl groups may influence its reactivity and potential applications in organic synthesis or as a pharmaceutical intermediate. The compound's amine functionality suggests it may engage in hydrogen bonding, affecting its physical properties such as boiling point and melting point. Additionally, due to its structural complexity, γ-Methoxy-γ-phenyl-N-2-propen-1-ylbenzenepropanamine may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and drug development.
Formula:C19H23NO
InChI:InChI=1S/C19H23NO/c1-3-15-20-16-14-19(21-2,17-10-6-4-7-11-17)18-12-8-5-9-13-18/h3-13,20H,1,14-16H2,2H3
InChI key:InChIKey=QFSWEWNANAHUNE-UHFFFAOYSA-N
SMILES:C(CCNCC=C)(OC)(C1=CC=CC=C1)C2=CC=CC=C2
Synonyms:- Benzenepropanamine, γ-methoxy-γ-phenyl-N-2-propen-1-yl-
- Alimadol
- γ-Methoxy-γ-phenyl-N-2-propen-1-ylbenzenepropanamine
- Benzenepropanamine, γ-methoxy-γ-phenyl-N-2-propenyl-
- 3-Methoxy-3,3-diphenyl-N-prop-2-enylpropan-1-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Alimadol
CAS:Alimadol is an opioid analgesic.Formula:C19H23NOColor and Shape:SolidMolecular weight:281.39
