CAS 52761-74-7
:4-(4H-1,2,4-triazol-4-yl)aniline
Description:
4-(4H-1,2,4-triazol-4-yl)aniline, with the CAS number 52761-74-7, is an organic compound characterized by the presence of both an aniline group and a triazole ring. This compound features a triazole moiety, which is a five-membered heterocyclic ring containing three nitrogen atoms, contributing to its potential biological activity and chemical reactivity. The aniline portion provides an amino group that can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Additionally, the presence of the triazole ring may impart antifungal or antimicrobial properties, making it of interest in medicinal chemistry. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C8H8N4
InChI:InChI=1/C8H8N4/c9-7-1-3-8(4-2-7)12-5-10-11-6-12/h1-6H,9H2
SMILES:c1cc(ccc1N)n1cnnc1
Synonyms:- Benzenamine, 4-(4H-1,2,4-triazol-4-yl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-(4-AMINOPHENYL)-1,2,4-TRIAZOLE
CAS:Formula:C8H8N4Purity:95%Color and Shape:SolidMolecular weight:160.17594-(4H-1,2,4-Triazol-4-yl)aniline
CAS:4-(4H-1,2,4-Triazol-4-yl)anilinePurity:95%Molecular weight:160.18g/mol4-(4H-1,2,4-Triazol-4-yl)aniline
CAS:4-(4H-1,2,4-Triazol-4-yl)aniline is a fluorescent dye that is used to study DNA and RNA. It has been used in single-crystal x-ray diffraction analysis to investigate the interconnection of water molecules. 4-(4H-1,2,4-Triazol-4-yl)aniline has also been used in x-ray diffraction analysis for determining the crystallographic structure of a molecule. This compound emits light when excited by an electron beam or other type of radiation. The emission spectrum can be used to identify the presence and concentration of this compound in solution. 4-(4H-1,2,4-Triazol-4-yl)aniline is usually prepared by a hydrothermal reaction between 2,6 diaminopyridine and 3 nitrobenzene.Formula:C8H8N4Purity:Min. 95%Molecular weight:160.18 g/mol



