CAS 52766-70-8

Medicarpin 3-O-glucoside

Description:

Medicarpin 3-O-glucoside is a flavonoid glycoside derived from medicarpin, which is a type of isoflavonoid. This compound is characterized by its glucoside structure, where a glucose molecule is attached to the medicarpin moiety, enhancing its solubility and bioavailability. Medicarpin itself is known for its antioxidant properties and potential health benefits, including anti-inflammatory and antimicrobial activities. The presence of the glucoside group may influence its pharmacokinetics and biological activity, making it more accessible for absorption in biological systems. Medicarpin 3-O-glucoside is typically found in various plant species, particularly in legumes, and may contribute to the overall health-promoting properties of these plants. Its CAS number, 52766-70-8, allows for precise identification in chemical databases and literature. Research into this compound continues to explore its potential applications in medicine and nutrition, particularly in the context of natural products and phytotherapy.

Formula: C₂₂H₂₄O₉

InChI: InChI=1S/C22H24O9/c1-27-10-2-4-12-14-9-28-15-7-11(3-5-13(15)21(14)30-16(12)6-10)29-22-20(26)19(25)18(24)17(8-23)31-22/h2-7,14,17-26H,8-9H2,1H3/t14-,17+,18+,19-,20+,21-,22+/m0/s1

InChI key: InChIKey=PVEMGMOWXQUWRD-NJAOXFEXSA-N

SMILES: O(C=1C=C2C([C@]3([C@](C=4C(O3)=CC(OC)=CC4)(CO2)[H])[H])=CC1)[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O

Synonyms:

• 6H-Benzofuro[3,2-c][1]benzopyran, β-D-glucopyranoside deriv.
• Medicarpin β-D-glucoside
• β-D-Glucopyranoside, 6a,11a-dihydro-9-methoxy-6H-benzofuro[3,2-c][1]benzopyran-3-yl, (6aR-cis)-
• (6aR,11aR)-6a,11a-Dihydro-9-methoxy-6H-benzofuro[3,2-c][1]benzopyran-3-yl β-D-glucopyranoside
• β-D-Glucopyranoside, (6aR,11aR)-6a,11a-dihydro-9-methoxy-6H-benzofuro[3,2-c][1]benzopyran-3-yl

Medicarpin 3-O-glucoside

CAS: 52766-70-8

Medicarpin-3-O-glucoside, a phytoalexin, inhibits the germination of G. intraradices spores and hyphal elongation.

Formula: C₂₂H₂₄O₉

Purity: 98%

Color and Shape: Solid

Molecular weight: 432.425

Ref: TM-TN4509

Medicarpin glucoside

CAS: 52766-70-8

Medicarpin glucoside is a potent bioactive compound, categorized as a flavonoid glycoside. This compound is derived from natural plant sources, specifically from the legume family, where it functions as a phytoalexin. The mode of action of medicarpin glucoside involves the inhibition of fungal growth and enhancement of plant defense mechanisms, providing potential benefits in agricultural applications.

Formula: C₂₂H₂₄O₉

Purity: Min. 95%

Molecular weight: 432.4 g/mol

Ref: 3D-CCA76670

β-D-Glucopyranoside, (6aR,11aR)-6a,11a-dihydro-9-methoxy-6H-benzofuro[3,2-c][1]benzopyran-3-yl

CAS: 52766-70-8

Formula: C₂₂H₂₄O₉

Purity: 98.0%

Color and Shape: Solid

Molecular weight: 432.4206

Ref: IN-DA01SOIP