CAS 527681-13-6

2,3-Dihydro-1,4-dioxino[2,3-c]pyridine-7-carboxylic acid

Description:

2,3-Dihydro-1,4-dioxino[2,3-c]pyridine-7-carboxylic acid is a heterocyclic organic compound characterized by its unique bicyclic structure that incorporates both a pyridine and a dioxin moiety. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of the dioxin ring system imparts distinct chemical properties, including potential for electrophilic substitution and reactivity with nucleophiles. The compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group, while its bicyclic structure may influence its stability and reactivity under various conditions. Additionally, compounds of this nature may possess biological activity, making them of interest in medicinal chemistry and drug development. The specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Overall, 2,3-Dihydro-1,4-dioxino[2,3-c]pyridine-7-carboxylic acid represents a complex structure with potential applications in various fields of chemistry.

Formula: C₈H₇NO₄

InChI: InChI=1S/C8H7NO4/c10-8(11)5-3-6-7(4-9-5)13-2-1-12-6/h3-4H,1-2H2,(H,10,11)

InChI key: InChIKey=BECXPUGKIFYJJE-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C2C(=CN1)OCCO2

Synonyms:

• 2,3-Dihydro-1,4-dioxino[2,3-c]pyridine-7-carboxylic acid
• 1,4-Dioxino[2,3-c]pyridine-7-carboxylic acid, 2,3-dihydro-
• 2H,3H-[1,4]Dioxino[2,3-c]pyridine-7-carboxylic acid

2H,3H-[1,4]Dioxino[2,3-c]pyridine-7-carboxylic acid

CAS: 527681-13-6

Versatile small molecule scaffold

Formula: C₈H₇NO₄

Purity: Min. 95%

Molecular weight: 181.15 g/mol

Ref: 3D-CWA68113