CAS 52773-82-7

3-hydroxynorleucine

Description:

3-Hydroxynorleucine is a non-proteinogenic amino acid that is structurally related to leucine, featuring a hydroxyl group at the third carbon position of the norleucine backbone. Its chemical formula is C₈H₁₅NO₂, and it is characterized by the presence of both an amino group and a hydroxyl group, which contribute to its polar nature and potential for hydrogen bonding. This compound is of interest in various biochemical and pharmaceutical contexts due to its potential role in metabolic processes and its influence on protein synthesis. 3-Hydroxynorleucine may exhibit biological activities that could be beneficial in areas such as muscle metabolism and energy regulation. Additionally, its unique structure allows it to interact with various biological systems, making it a subject of research in fields like nutrition and medicinal chemistry. As with many amino acids, its solubility in water and stability under physiological conditions are important characteristics that influence its functionality in biological systems.

Formula: C₆H₁₃NO₃

InChI: InChI=1/C6H13NO3/c1-2-3-4(8)5(7)6(9)10/h4-5,8H,2-3,7H2,1H3,(H,9,10)

SMILES: CCCC(C(C(=O)O)N)O

2-Amino-3-hydroxyhexanoic Acid

Controlled Product

CAS: 52773-82-7

Formula: C₆H₁₃NO₃

Color and Shape: Neat

Molecular weight: 147.172

Ref: TR-B405773

2-Amino-3-hydroxyhexanoic acid

CAS: 52773-82-7

2-Amino-3-hydroxyhexanoic acid is a quantifiable amino acid that is found in biological samples. It can be detected by gas liquid chromatography, which uses a calibration curve to quantify the amount of 2-amino-3-hydroxyhexanoic acid present in a sample. This amino acid is found in the tissue homogenates and hydrazones of acetaldehyde and threonine, which are metabolites of alcohol consumption. The detection limit for 2-amino-3-hydroxyhexanoic acid is 0.1 mg/dL.

Formula: C₆H₁₃NO₃

Purity: Min. 95%

Molecular weight: 147.17 g/mol

Ref: 3D-CCA77382