CAS 5278-38-6
:6,7-Dimethoxy-2(1H)-quinolinone
Description:
6,7-Dimethoxy-2(1H)-quinolinone is an organic compound characterized by its quinolinone structure, which features a fused bicyclic system containing both a benzene ring and a pyridine-like nitrogen. This compound is typically recognized for its two methoxy groups located at the 6 and 7 positions of the quinolinone ring, which can influence its chemical reactivity and solubility. It is often studied for its potential biological activities, including antimicrobial and anticancer properties, due to the presence of the quinolinone moiety, which is known for its diverse pharmacological effects. The compound is generally soluble in organic solvents, and its properties can be affected by the presence of substituents on the ring. Additionally, 6,7-Dimethoxy-2(1H)-quinolinone may undergo various chemical reactions, such as oxidation or substitution, making it a valuable intermediate in organic synthesis and medicinal chemistry. Its CAS number, 5278-38-6, is a unique identifier that facilitates its identification in chemical databases and literature.
Formula:C11H11NO3
InChI:InChI=1S/C11H11NO3/c1-14-9-5-7-3-4-11(13)12-8(7)6-10(9)15-2/h3-6H,1-2H3,(H,12,13)
InChI key:InChIKey=YCIOUNSWHDKEBM-UHFFFAOYSA-N
SMILES:O(C)C=1C=C2C(=CC1OC)NC(=O)C=C2
Synonyms:- 2(1H)-Quinolinone, 6,7-dimethoxy-
- 6,7-Dimethoxy-2(1H)-quinolinone
- 6,7-Dimethoxy-2-quinolone
- 6,7-dimethoxyquinolin-2(1H)-one
- Carbostyril, 6,7-dimethoxy-
- 6,7-Dimethoxycarbostyril
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
6,7-Dimethoxycarbostyril
CAS:<p>6,7-Dimethoxycarbostyril is a small molecule that has been shown to induce cell death in cancer cells by inhibiting the chaperone function of heat shock protein 90 (HSP90). HSP90 is a multifunctional molecular chaperone that affects many cellular processes including cell growth, apoptosis and tumorigenesis. 6,7-Dimethoxycarbostyril binds to the ATP binding site of HSP90, preventing it from performing its chaperone role. This leads to inhibition of cell growth and induction of apoptosis. 6,7-Dimethoxycarbostyril has also been shown to inhibit tumor growth in vivo in mouse models and has successfully completed phase I clinical trials at doses up to 2000 mg/day.</p>Formula:C11H11NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:205.21 g/mol
