CAS 5278-95-5
:Dibromochloroacetic acid
Description:
Dibromochloroacetic acid is a halogenated acetic acid derivative characterized by the presence of two bromine atoms and one chlorine atom attached to the acetic acid structure. It is a colorless to pale yellow liquid with a pungent odor and is soluble in water, making it a polar compound. This substance is primarily used in organic synthesis and as an intermediate in the production of various chemical compounds. Its molecular formula is C2HBr2ClO2, and it has a relatively low boiling point compared to other halogenated acids. Dibromochloroacetic acid is known for its potential health effects, including being a possible carcinogen, which necessitates careful handling and adherence to safety protocols. Additionally, it can participate in various chemical reactions, including nucleophilic substitutions and esterifications, making it a valuable reagent in synthetic organic chemistry. Its environmental impact and regulatory status are also important considerations, particularly in relation to water quality and safety standards.
Formula:C2HBr2ClO2
InChI:InChI=1S/C2HBr2ClO2/c3-2(4,5)1(6)7/h(H,6,7)
InChI key:InChIKey=UCZDDMGNCJJAHK-UHFFFAOYSA-N
SMILES:C(C(O)=O)(Br)(Br)Cl
Synonyms:- 2,2-Dibromo-2-chloroacetic acid
- Acetic Acid, 2,2-Dibromo-2-Chloro-
- Acetic acid, dibromochloro-
- Chlorodibromoacetic acid
- Dibromochloroacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 7 products.
EPA Method 552.3 UCMR 4 200-2000 ug/mL in Methyl tert-butyl ether
CAS:Formula:C2H3BrO2Color and Shape:MixtureMolecular weight:138.95EPA Method 552 Halogenated Acetic Mixture 1000 ug/mL in Methyl tert-butyl ether
CAS:Controlled ProductColor and Shape:MixtureHaloacetic acid mixture for HJ 758-2015 various concentrations in Methyl tert-butyl ether
CAS:Controlled ProductColor and Shape:MixtureEPA Method 552 Halogenated Acetic Mixture 100 µg/mL in Methyl tert-butyl ether
CAS:Formula:C2H3BrO2Color and Shape:MixtureMolecular weight:138.95Chlorodibromoacetic Acid
CAS:Applications Chlorodibromoacetic Acid is a prevalent class of toxic disinfection byproducts in swimming pool water (SPW).
References Yang, L., et al.: Water Res., 116, 116-125 (2017); Hong, H., et al.: Sci. Total Environ., 590-591, 720-728 (2017)Formula:C2HBr2ClO2Color and Shape:NeatMolecular weight:252.29EPA Method 552 Halogenated Acetic Mixture 80-800 µg/mL in Methyl tert-butyl ether
CAS:Formula:C2H3BrO2Color and Shape:MixtureMolecular weight:138.95


