CymitQuimica logo

CAS 5278-95-5

:

Dibromochloroacetic acid

Description:
Dibromochloroacetic acid is a halogenated acetic acid derivative characterized by the presence of two bromine atoms and one chlorine atom attached to the acetic acid structure. It is a colorless to pale yellow liquid with a pungent odor and is soluble in water, making it a polar compound. This substance is primarily used in organic synthesis and as an intermediate in the production of various chemical compounds. Its molecular formula is C2HBr2ClO2, and it has a relatively low boiling point compared to other halogenated acids. Dibromochloroacetic acid is known for its potential health effects, including being a possible carcinogen, which necessitates careful handling and adherence to safety protocols. Additionally, it can participate in various chemical reactions, including nucleophilic substitutions and esterifications, making it a valuable reagent in synthetic organic chemistry. Its environmental impact and regulatory status are also important considerations, particularly in relation to water quality and safety standards.
Formula:C2HBr2ClO2
InChI:InChI=1S/C2HBr2ClO2/c3-2(4,5)1(6)7/h(H,6,7)
InChI key:InChIKey=UCZDDMGNCJJAHK-UHFFFAOYSA-N
SMILES:C(C(O)=O)(Br)(Br)Cl
Synonyms:
  • 2,2-Dibromo-2-chloroacetic acid
  • Acetic Acid, 2,2-Dibromo-2-Chloro-
  • Acetic acid, dibromochloro-
  • Chlorodibromoacetic acid
  • Dibromochloroacetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 7 products.