CAS 52781-00-7
:N-pyridin-2-ylethanediamide
Description:
N-pyridin-2-ylethanediamide, with the CAS number 52781-00-7, is an organic compound characterized by its amide functional groups and a pyridine ring. This compound features a two-carbon ethylene chain connecting two amine groups to a pyridine moiety, which contributes to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amide groups, which can engage in hydrogen bonding. The pyridine ring imparts basicity and aromatic characteristics, influencing its reactivity and interaction with other chemical species. N-pyridin-2-ylethanediamide may be utilized in various applications, including as a ligand in coordination chemistry or as a building block in organic synthesis. Its structural features suggest potential biological activity, making it of interest in pharmaceutical research. However, specific safety and handling guidelines should be followed, as with any chemical substance, to ensure safe usage in laboratory settings.
Formula:C7H7N3O2
InChI:InChI=1/C7H7N3O2/c8-6(11)7(12)10-5-3-1-2-4-9-5/h1-4H,(H2,8,11)(H,9,10,12)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
N1-2-Pyridinylethanediamide
CAS:Controlled ProductFormula:C7H7N3O2Color and Shape:NeatMolecular weight:165.149

