CAS 528-04-1
:UDP-N-acetyl-D-glucosamine
Description:
UDP-N-acetyl-D-glucosamine (UDP-GlcNAc) is a nucleotide sugar that plays a crucial role in various biological processes, particularly in glycosylation reactions. It is a derivative of uridine diphosphate (UDP) and N-acetyl-D-glucosamine, serving as an essential substrate for the synthesis of glycoproteins and glycolipids. UDP-GlcNAc is involved in the biosynthesis of peptidoglycan in bacterial cell walls and is a key component in the formation of chitin in fungi and arthropods. The compound is typically a white to off-white solid, soluble in water, and exhibits stability under physiological conditions. Its structure features a uridine moiety linked to a sugar, which is modified by an acetyl group, contributing to its biological activity. UDP-GlcNAc is also implicated in signaling pathways and cellular processes, including cell differentiation and immune responses. Due to its central role in metabolism and cell signaling, UDP-N-acetyl-D-glucosamine is of significant interest in biochemistry and pharmacology.
Formula:C17H27N3O17P2
InChI:InChI=1S/C17H27N3O17P2/c1-6(22)18-10-13(26)11(24)7(4-21)35-16(10)36-39(31,32)37-38(29,30)33-5-8-12(25)14(27)15(34-8)20-3-2-9(23)19-17(20)28/h2-3,7-8,10-16,21,24-27H,4-5H2,1H3,(H,18,22)(H,29,30)(H,31,32)(H,19,23,28)/t7-,8-,10-,11-,12-,13-,14-,15-,16-/m1/s1
InChI key:InChIKey=LFTYTUAZOPRMMI-CFRASDGPSA-N
SMILES:O[C@H]1[C@@H](O[C@H](COP(OP(O[C@@H]2[C@H](NC(C)=O)[C@@H](O)[C@H](O)[C@@H](CO)O2)(=O)O)(=O)O)[C@H]1O)N3C(=O)NC(=O)C=C3
Synonyms:- Uridine 5′-(2-acetamido-2-deoxy-α-D-glucosyl pyrophosphate)
- UDP N-acetyl-α-D-glucosamine
- Uridine 5′-(trihydrogen pyrophosphate), mono(2-acetamido-2-deoxy-α-D-glucopyranosyl) ester
- Uridine 5′-(trihydrogen diphosphate), P′-[2-(acetylamino)-2-deoxy-α-D-glucopyranosyl] ester
- Uridine pyrophosphate, 2-acetamido-2-deoxy-α-D-glucopyranosyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Uridine 5’-Diphospho-N-acetylglucosamine-13C,d3
CAS:Controlled ProductFormula:C16CH24D3N3O17P2Color and Shape:NeatMolecular weight:611.36UDP-N-acetyl-D-glucosamine
CAS:UDP-N-acetyl-D-glucosamine is a nucleotide that is found in the cell membrane of Gram-positive bacteria. It has been shown to inhibit the growth of bacteria by binding to the 50S ribosomal subunit. This binding prevents the formation of an antibiotic-inhibitor complex with the enzyme cell wall synthesis that is required for cell wall biosynthesis, inhibiting protein synthesis and cell division. UDP-N-acetyl-D-glucosamine has also been shown to be a substrate for glycosylation enzymes, which are involved in the production of glycogen, chitin, and other polysaccharides.Formula:C17H27N3O17P2Purity:Min. 95%Color and Shape:PowderMolecular weight:607.35 g/mol

