CAS 528-53-0: Delphinidin chloride
Description:Delphinidin chloride is a naturally occurring anthocyanidin, a type of flavonoid pigment found in various fruits and flowers, contributing to their red, blue, or purple colors. It is characterized by its chemical formula, which typically includes a hydroxyl group and a methoxy group, influencing its solubility and stability. Delphinidin chloride is known for its antioxidant properties, which can help protect cells from oxidative stress. It exhibits a strong absorption in the visible light spectrum, making it useful in food coloring and as a natural dye. The compound is soluble in water and alcohol, but its stability can be affected by pH and light exposure. Additionally, delphinidin has been studied for its potential health benefits, including anti-inflammatory and anti-cancer properties. Its chloride form indicates the presence of chloride ions, which may influence its reactivity and interactions in various chemical environments. Overall, delphinidin chloride is a significant compound in both natural products chemistry and potential therapeutic applications.
Formula:C15H11O7·Cl
InChI:InChI=1S/C15H10O7.ClH/c16-7-3-9(17)8-5-12(20)15(22-13(8)4-7)6-1-10(18)14(21)11(19)2-6;/h1-5H,(H5-,16,17,18,19,20,21);1H
InChI key:InChIKey=FFNDMZIBVDSQFI-UHFFFAOYSA-N
SMILES:[Cl-].OC=1C=C(O)C=2C=C(O)C(=[O+]C2C1)C=3C=C(O)C(O)=C(O)C3
- Synonyms:
- 1-Benzopyrylium, 3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)-, chloride
- 1-Benzopyrylium, 3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)-, chloride (1:1)
- 3,3′,4′,5,5′,7-Hexahydroxy-2-phenylbenzopyrylium chloride
- 3,3′,4′,5,5′,7-Hexahydroxyflavylium chloride
- 3,5,7-Trihydroxy-2-(3,4,5-Trihydroxyphenyl)Chromenium Chloride
- 3,5,7-Trihydroxy-2-(3,4,5-trihydroxyphenyl)-1-benzopyrylium chloride
- Ccris 2518
- Delfinidol chloride
- Delphinidin
- Delphinidin Chloride
- See more synonyms
- Delphinidine
- Delphinidol
- Ephdine
- Flavylium 3,3',4',5,5',7-hexahydroxy-, chloride (8CI)
- Flavylium, 3,3′,4′,5,5′,7-hexahydroxy-, chloride
- IdB 1056
- 3,5,7-Trihydroxy-2-(3,4,5-trihydroxyphenyl)benzopyrylium chloride
