CAS 528-58-5: Cyanidin chloride
Description:Cyanidin chloride is a chemical compound classified as a flavonoid, specifically an anthocyanidin, which is known for its vibrant red to purple coloration. It is derived from various plant sources, particularly fruits and flowers, where it contributes to the pigmentation. The compound has a molecular formula that reflects its structure, which includes multiple hydroxyl groups that enhance its solubility in water and its antioxidant properties. Cyanidin chloride is often studied for its potential health benefits, including anti-inflammatory and anti-cancer effects, attributed to its ability to scavenge free radicals. In terms of physical properties, it typically appears as a dark-colored powder or crystalline solid. The compound is soluble in water and alcohol, making it useful in various applications, including food coloring and natural dyes. Additionally, it has been investigated for its role in plant biology and its potential therapeutic applications in human health. As with many anthocyanins, its stability can be affected by pH and temperature, which is important for its use in food and pharmaceutical industries.
Formula:C15H11O6·Cl
InChI:InChI=1S/C15H10O6.ClH/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7;/h1-6H,(H4-,16,17,18,19,20);1H
InChI key:InChIKey=COAWNPJQKJEHPG-UHFFFAOYSA-N
SMILES:[Cl-].OC=1C=C(O)C=2C=C(O)C(=[O+]C2C1)C=3C=CC(O)=C(O)C3
- Synonyms:
- 1-Benzopyrylium, 2-(3,4-Dihydroxyphenyl)-3,5,7-Trihydroxy-, Chloride (1:1)
- 1-Benzopyrylium, 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-, chloride
- 2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxy-1-benzopyrylium chloride
- 2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxychromenium chloride
- 2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxychromeniumchlorid
- 3,3',4',5,7-Pentahydroxy-2-phenylbenzopyrylium chloride
- 3,3',4',5,7-Pentahydroxyflavylium Chloride
- 3,3',4',5,7-Pentahydroxyflavyliumchlorid
- 3,3′,4′,5,7-Pentahydroxy-2-phenylbenzopyrylium chloride
- 3,3′,4′,5,7-Pentahydroxyflavylium chloride
- See more synonyms
- Chlorure De 3,3',4',5,7-Pentahydroxyflavylium
- Cloruro De 3,3',4',5,7-Pentahidroxiflavilio
- Cyanidin
- Cyanidine
- Cyanidol
- Cyanidol chloride
- Flavylium, 3,3',4',5,7-pentahydroxy-, chloride
- Flavylium, 3,3′,4′,5,7-pentahydroxy-, chloride
- IdB 1027
