CAS 528-63-2
:Galgravin
Description:
Galgravin, with the CAS number 528-63-2, is a chemical compound that belongs to the class of anthraquinones. It is primarily recognized for its use in various applications, including as a dye and in the field of organic synthesis. Galgravin exhibits a characteristic deep color, which is typical of many anthraquinone derivatives, making it valuable in textile and pigment industries. The compound is known for its stability and resistance to fading, which enhances its utility in dye formulations. Additionally, galgravin may exhibit biological activity, although specific pharmacological properties can vary. Its solubility is generally moderate, depending on the solvent used, and it may undergo various chemical reactions, including reduction and substitution, which are common for anthraquinone compounds. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, galgravin's unique properties make it a noteworthy compound in both industrial and research contexts.
Formula:C22H28O5
InChI:InChI=1/C22H28O5/c1-13-14(2)22(16-8-10-18(24-4)20(12-16)26-6)27-21(13)15-7-9-17(23-3)19(11-15)25-5/h7-14,21-22H,1-6H3/t13-,14+,21-,22+
InChI key:InChIKey=JLJAVUZBHSLLJL-DQEHQXCCNA-N
SMILES:C[C@@H]1[C@H](O[C@H]([C@@H]1C)C2=CC(OC)=C(OC)C=C2)C3=CC(OC)=C(OC)C=C3
Synonyms:- (±)-Galgravin
- Furan, 2,5-bis(3,4-dimethoxyphenyl)tetrahydro-3,4-dimethyl-, (2R,3R,4S,5S)-rel-
- Furan, 2,5-bis(3,4-dimethoxyphenyl)tetrahydro-3,4-dimethyl-, (2α,3β,4β,5α)-
- furan, 2,5-bis(3,4-dimethoxyphenyl)tetrahydro-3,4-dimethyl-, (2R,3R,4S,5S)-
- rel-(2R,3R,4S,5S)-2,5-Bis(3,4-dimethoxyphenyl)tetrahydro-3,4-dimethylfuran
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Galgravin
CAS:Galgravin combats inflammation, safeguards neurons, promotes neurite growth, and resists Abeta25-35 and MPP+ toxicity.
Formula:C22H28O5Purity:99.75% - 99.88%Color and Shape:SolidMolecular weight:372.45Galgravin
CAS:Galgravin is a natural compound that belongs to the family of antimicrobial agents. It is a protocatechuic acid glycoside derived from Ganoderma lucidum, which has been shown to have antitumor and anti-inflammatory properties. Galgravin is also an effective inhibitor of Leishmania parasites, inhibiting their growth and development by interfering with nucleic acid metabolism. This compound has been shown to inhibit the synthesis of dNTPs in rat neuronal cells, resulting in neuronal death and neuroprotection. Galgravin is a chemical substance that can be found in many food items such as wine, tea, chocolate, and cheese.
Formula:C22H28O5Purity:Min. 95%Molecular weight:372.5 g/mol





