CAS 528-71-2
:Hydroxyphenazine; 95%
Description:
Hydroxyphenazine, with the CAS number 528-71-2, is a chemical compound that belongs to the phenazine family, characterized by its bicyclic structure containing nitrogen atoms. It typically appears as a dark-colored solid or powder and is known for its potential applications in various fields, including pharmaceuticals and dyes. The compound exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many phenazine derivatives. Hydroxyphenazine can participate in redox reactions due to its ability to undergo oxidation and reduction, making it useful in electrochemical applications. Additionally, it may exhibit biological activity, including antimicrobial properties, which has garnered interest in medicinal chemistry. However, handling this compound requires caution due to its potential toxicity and the need for appropriate safety measures in laboratory settings. Overall, hydroxyphenazine is a versatile compound with significant relevance in both industrial and research contexts.
Formula:C12H8N2O
InChI:InChI=1/C12H8N2O/c15-11-7-3-6-10-12(11)14-9-5-2-1-4-8(9)13-10/h1-7,15H
InChI key:InChIKey=SVRNCBGWUMMBQB-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)nc1cccc(c1n2)O
Synonyms:- 1-Hydroxy-9,10-diazaanthracene
- 1-Hydroxyphenazine
- 1-Phenazinol
- Hemipyocyanin
- Hemipyocyanine
- NSC 88882
- Phenazin-1-Ol
- Pyoxanthose
- phenazin-1(5H)-one
- α-Hydroxyphenazine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
1-Hydroxyphenazine
CAS:Formula:C12H8N2OPurity:>95.0%(GC)Color and Shape:Light yellow to Brown powder to crystalineMolecular weight:196.211-Hydroxyphenazine
CAS:1-Hydroxyphenazine is an anti-fungal agent that inhibits the growth of opportunistic fungal pathogens. It has been shown to be effective in vitro against some bacteria, including Staphylococcus aureus and Pseudomonas aeruginosa, but not against others such as Escherichia coli. 1-Hydroxyphenazine reacts with intracellular Ca2+ to activate the reactive oxygen species (ROS), which are cytotoxic to fungi and other microorganisms. The compound is a structural analog of phenazone, but has higher antimicrobial activity and lower toxicity. 1-Hydroxyphenazine also chelates metal ions and forms stable complexes with them. This property may contribute to its biological properties.
Formula:C12H8N2OPurity:Min. 95%Molecular weight:196.21 g/molHemipyocyanine
CAS:Hemipyocyanine (528-71-2) is the virulence factor of Gram-negative, aerobic rod bacterium Pseudomonas aeruginosa. Hemipyocyanine is an α-Amylase inhibitor.Formula:C12H8N2OPurity:99.02% - 99.75%Color and Shape:SolidMolecular weight:196.2






