CAS 528-90-5
:2,4,5-Trimethylbenzoic acid
Description:
2,4,5-Trimethylbenzoic acid, with the CAS number 528-90-5, is an aromatic carboxylic acid characterized by a benzene ring substituted with three methyl groups at the 2, 4, and 5 positions, along with a carboxylic acid functional group (-COOH) at the 1-position. This compound typically appears as a white to light yellow crystalline solid and is known for its relatively low solubility in water, while being more soluble in organic solvents. It has a melting point that varies depending on purity and specific conditions. The presence of multiple methyl groups contributes to its hydrophobic nature and influences its reactivity and interactions with other chemical species. 2,4,5-Trimethylbenzoic acid is utilized in various applications, including as an intermediate in organic synthesis and in the production of certain polymers and resins. Its chemical structure allows for potential applications in pharmaceuticals and agrochemicals, where it may serve as a building block for more complex molecules. Safety data should be consulted for handling and exposure guidelines.
Formula:C10H12O2
InChI:InChI=1S/C10H12O2/c1-6-4-8(3)9(10(11)12)5-7(6)2/h4-5H,1-3H3,(H,11,12)
InChI key:InChIKey=QENJZWZWAWWESF-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C)C=C(C)C(C)=C1
Synonyms:- Benzoic acid, 2,4,5-trimethyl-
- Brn 2084752
- Durylic acid
- Nsc 147400
- 2,4,5-Trimethylbenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,4,5-Trimethylbenzoic Acid
CAS:Formula:C10H12O2Purity:>97.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:164.202,4,5-Trimethylbenzoic acid
CAS:Formula:C10H12O2Purity:98%Color and Shape:SolidMolecular weight:164.20112,4,5-Trimethylbenzoic acid
CAS:2,4,5-Trimethylbenzoic acid is a white crystalline solid that is soluble in water. It is used as an analytical reagent and oxidation catalyst. 2,4,5-Trimethylbenzoic acid can be found in polymer films and inorganic acids. The oxidation products of 2,4,5-Trimethylbenzoic acid are known to have antioxidant properties. The compound can be found as an oxidant or an activator in organic synthesis reactions. 2,4,5-Trimethylbenzoic acid has been used as a starting material for the synthesis of acyl halides and carboxylates. It also has been used to synthesize fatty acids from unsaturated hydrocarbons.Formula:C10H12O2Purity:Min. 95%Color and Shape:PowderMolecular weight:164.2 g/mol2,4,5-Trimethylbenzoic acid
CAS:Formula:C10H12O2Purity:95%Color and Shape:SolidMolecular weight:164.204




