CAS 52805-46-6
:3-Hydroxy-4-methoxybenzonitrile
Description:
3-Hydroxy-4-methoxybenzonitrile, with the CAS number 52805-46-6, is an organic compound characterized by the presence of a hydroxyl group (-OH) and a methoxy group (-OCH3) attached to a benzene ring, along with a nitrile group (-C≡N). This compound typically appears as a solid at room temperature and is soluble in polar organic solvents. Its molecular structure suggests it may exhibit both acidic and basic properties due to the hydroxyl group, which can participate in hydrogen bonding. The presence of the nitrile group contributes to its potential reactivity, making it useful in various chemical syntheses. Additionally, the methoxy group can influence the compound's electronic properties, affecting its reactivity and interaction with other molecules. 3-Hydroxy-4-methoxybenzonitrile may find applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, owing to its functional groups that can undergo further chemical transformations. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C8H7NO2
InChI:InChI=1S/C8H7NO2/c1-11-8-3-2-6(5-9)4-7(8)10/h2-4,10H,1H3
InChI key:InChIKey=ASQHIJLQYYFUDN-UHFFFAOYSA-N
SMILES:C(#N)C1=CC(O)=C(OC)C=C1
Synonyms:- 2-Methoxy-5-cyanophenol
- 3-Hydroxy-4-Methoxybenzonitrile (Isovanillonitrile)
- 5-Cyano-2-methoxyphenol
- Benzonitrile, 3-hydroxy-4-methoxy-
- Isovanillonitrile
- 3-Hydroxy-4-methoxybenzonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Hydroxy-4-methoxybenzonitrile
CAS:Formula:C8H7NO2Purity:97%Color and Shape:SolidMolecular weight:149.1467Gefitinib Impurity (3-Hydroxy-4-methoxybenzonitrile)
CAS:Formula:C8H7NO2Color and Shape:Off-White SolidMolecular weight:149.153-Hydroxy-4-methoxy benzonitrile
CAS:3-Hydroxy-4-methoxy benzonitrilePurity:98%Molecular weight:149.15g/mol3-Hydroxy-4-methoxybenzonitrile
CAS:The synthesis of 3-hydroxy-4-methoxybenzonitrile (3HMB) is achieved by the reaction of bromoethane, chloride and methylating agents in hydrochloric acid. This process yields a mixture of products that are separated by fractional distillation. The reaction yield of 3HMB is dependent on the amount of epidermal growth factor (EGF), which can be increased by adding morpholine to the reaction mixture. 3HMB is also a growth factor that has been shown to stimulate cell proliferation and differentiation in vitro. It binds to the epidermal growth factor receptor and stimulates EGF-dependent signal transduction pathways, leading to activation of protein kinase C and mitogen-activated protein kinase.Formula:C8H7NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:149.15 g/mol3-Hydroxy-4-methoxybenzonitrile
CAS:Formula:C8H7NO2Purity:98%Color and Shape:Grey powderMolecular weight:149.149





