CAS 52834-08-9

4-amino-5-bromopyridine-3-carboxylic acid

Description:

4-Amino-5-bromopyridine-3-carboxylic acid is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH) that contribute to its polar nature, enhancing its solubility in water. The presence of a bromine atom at the 5-position of the pyridine ring introduces a halogen substituent, which can influence the compound's reactivity and potential applications in synthesis. The amino group can participate in hydrogen bonding, making it a potential candidate for various biological activities, including antimicrobial and anti-inflammatory properties. Additionally, the carboxylic acid group can act as a proton donor, making the compound acidic. Its structural features suggest potential utility in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Overall, 4-amino-5-bromopyridine-3-carboxylic acid is a versatile compound with significant implications in medicinal chemistry and related fields.

Formula: C₆H₅BrN₂O₂

InChI: InChI=1/C6H5BrN2O2/c7-4-2-9-1-3(5(4)8)6(10)11/h1-2H,(H2,8,9)(H,10,11)

SMILES: c1c(c(=N)c(c[nH]1)Br)C(=O)O

4-Amino-5-bromonicotinic acid

CAS: 52834-08-9

Formula: C₆H₅BrN₂O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 217.0201

Ref: IN-DA00373V

4-Amino-5-bromonicotinic acid

CAS: 52834-08-9

4-Amino-5-bromonicotinic acid

Purity: 96%

Molecular weight: 217.02g/mol

Ref: 54-OR94906

4-Amino-5-bromonicotinic acid

CAS: 52834-08-9

Formula: C₆H₅BrN₂O₂

Purity: 95%

Color and Shape: Solid, White powder

Molecular weight: 217.022

Ref: 10-F239740