CAS 52838-39-8

5-Methyl-1,3,4-oxadiazol-2-ylamine

Description:

5-Methyl-1,3,4-oxadiazol-2-ylamine is an organic compound characterized by its oxadiazole ring, which consists of nitrogen and oxygen atoms. This compound features a methyl group at the 5-position of the oxadiazole ring and an amino group at the 2-position, contributing to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The oxadiazole moiety is known for its applications in pharmaceuticals and agrochemicals, often serving as a scaffold for drug development. The compound may also display interesting properties such as antimicrobial or antifungal activity, although specific biological activities would depend on further empirical studies. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, 5-Methyl-1,3,4-oxadiazol-2-ylamine represents a versatile structure in organic chemistry with potential applications in various fields.

Formula: C₃H₅N₃O

InChI: InChI=1/C3H5N3O/c1-2-5-6-3(4)7-2/h1H3,(H2,4,6)

SMILES: Cc1n[nH]c(=N)o1

Synonyms:

• 5-Methyl-1,3,4-Oxadiazol-2-Amine

5-Methyl-1,3,4-oxadiazol-2-ylamine

CAS: 52838-39-8

Formula: C₃H₅N₃O

Purity: 97%

Color and Shape: Solid

Molecular weight: 99.0913

Ref: IN-DA00D8XY

5-Methyl-1,3,4-oxadiazol-2-ylamine

CAS: 52838-39-8

5-Methyl-1,3,4-oxadiazol-2-ylamine

Purity: 97%

Molecular weight: 99.09129g/mol

Ref: 54-OR301230

5-Methyl-1,3,4-oxadiazol-2-amine

CAS: 52838-39-8

Formula: C₃H₅N₃O

Color and Shape: Neat

Ref: TR-B496003

5-Methyl-1,3,4-oxadiazol-2-ylamine

CAS: 52838-39-8

Formula: C₃H₅N₃O

Purity: 97%

Color and Shape: Solid

Molecular weight: 99.093

Ref: 10-F009900