CAS 52845-68-8

N-(4-Methyl-3-chlorophenyl)maleimide

Description:

N-(4-Methyl-3-chlorophenyl)maleimide, with the CAS number 52845-68-8, is an organic compound characterized by its maleimide structure, which features a five-membered ring containing a carbonyl and an imide functional group. This compound is typically a solid at room temperature and exhibits a crystalline appearance. It is known for its reactivity, particularly in Michael addition reactions, due to the presence of the maleimide moiety, which can participate in nucleophilic attacks. The chlorophenyl group contributes to its electronic properties, potentially enhancing its reactivity and solubility in organic solvents. This compound is often utilized in polymer chemistry and materials science, particularly in the synthesis of specialty polymers and as a crosslinking agent. Its unique structure allows for various applications in the development of advanced materials, including those used in electronics and coatings. Safety data should be consulted for handling, as it may pose health risks if proper precautions are not taken.

Formula: C₁₁H₈ClNO₂

InChI: InChI=1/C11H8ClNO2/c1-7-2-3-8(6-9(7)12)13-10(14)4-5-11(13)15/h2-6H,1H3

SMILES: Cc1ccc(cc1Cl)N1C(=O)C=CC1=O

Synonyms:

• 1-(3-Chloro-4-methylphenyl)-1H-pyrrole-2,5-dione

N-(4-Methyl-3-chlorophenyl)maleimide

CAS: 52845-68-8

Formula: C₁₁H₈ClNO₂

Purity: 98%

Molecular weight: 221.6397

Ref: IN-DA003SD2

1-(3-Chloro-4-methylphenyl)maleimide

CAS: 52845-68-8

1-(3-Chloro-4-methylphenyl)maleimide

Purity: ≥95%

Ref: 54-OR7275

1-(3-chloro-4-methylphenyl)-1H-pyrrole-2,5-dione

CAS: 52845-68-8

Formula: C₁₁H₈ClNO₂

Purity: 98%

Molecular weight: 221.64

Ref: 10-F371794