
CAS 5285-18-7
:5-(1,3-Benzodioxol-5-yl)-2,4-pentadienoic acid
Description:
5-(1,3-Benzodioxol-5-yl)-2,4-pentadienoic acid, also known by its CAS number 5285-18-7, is an organic compound characterized by its unique structure that includes a benzodioxole moiety and a pentadienoic acid chain. This compound typically exhibits properties associated with both aromatic and unsaturated carboxylic acids, which may include moderate solubility in organic solvents and limited solubility in water due to its hydrophobic aromatic component. The presence of the diene system suggests potential for reactivity in various chemical reactions, such as electrophilic addition or polymerization. Additionally, the benzodioxole group may impart specific biological activities, making this compound of interest in medicinal chemistry and natural product synthesis. Its structural features may also contribute to its stability and reactivity under different conditions. Overall, 5-(1,3-Benzodioxol-5-yl)-2,4-pentadienoic acid is a compound with intriguing chemical properties that warrant further investigation for potential applications in various fields, including pharmaceuticals and materials science.
Formula:C12H10O4
InChI:InChI=1S/C12H10O4/c13-12(14)4-2-1-3-9-5-6-10-11(7-9)16-8-15-10/h1-7H,8H2,(H,13,14)
InChI key:InChIKey=RHBGITBPARBDPH-UHFFFAOYSA-N
SMILES:C(=CC=CC(O)=O)C=1C=C2C(=CC1)OCO2
Synonyms:- 2,4-Pentadienoic acid, 5-(1,3-benzodioxol-5-yl)-
- 5-(1,3-Benzodioxol-5-yl)-2,4-pentadienoic acid
- NSC 129538
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Piperic acid
CAS:Piperic acid is a powerful antioxidant and has potent antibacterial propertiesFormula:C12H10O4Color and Shape:SolidMolecular weight:218.21

