CAS 52853-40-4
:6-(Bromomethyl)pteridine-2,4-diamine hydrobromide (1:1)
Description:
6-(Bromomethyl)pteridine-2,4-diamine hydrobromide is a chemical compound characterized by its pteridine core structure, which is a bicyclic compound containing nitrogen atoms. This substance features a bromomethyl group, which enhances its reactivity and potential applications in organic synthesis. The presence of two amino groups at the 2 and 4 positions of the pteridine ring contributes to its basicity and ability to form salts, such as the hydrobromide form, which is a common method to enhance solubility in polar solvents. The hydrobromide salt indicates that the compound is protonated, making it more stable and easier to handle in laboratory settings. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural similarity to biologically active molecules. Additionally, its bromine substituent can serve as a useful handle for further chemical modifications. As with many nitrogen-containing heterocycles, it may exhibit interesting biological activities, warranting further investigation.
Formula:C7H8Br2N6
InChI:InChI=1/C7H7BrN6.BrH/c8-1-3-2-11-6-4(12-3)5(9)13-7(10)14-6;/h2H,1H2,(H4,9,10,11,13,14);1H
SMILES:C(c1cnc2c(c(N)[nH]c(=N)n2)n1)Br.Br
Synonyms:- 2,4-Pteridinediamine, 6-(Bromomethyl)-, Hydrobromide (1:1)
- 6-Bromomethyl-Pteridine-2,4-Diamine Hbr
- 2,4-Diamino-6-(Bromomethyl)Pteridine
- 2,4-Diamino-6-(bromomethyl)pteridine hydrobromide
- 6-(Bromomethyl)-2,4-pteridinediamine Hydrobromide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,4-Diamino-6-(bromomethyl)pteridine hydrobromide
CAS:Formula:C7H8Br2N6Purity:90%Color and Shape:SolidMolecular weight:335.98666-(Bromomethyl)-2,4-Pteridinediamine Hydrobromide
CAS:6-(Bromomethyl)-2,4-Pteridinediamine HydrobromidePurity:90%Molecular weight:335.99g/mol6-(Bromomethyl)-2,4-pteridinediamine hydrobromide
CAS:6-(Bromomethyl)-2,4-pteridinediamine hydrobromide is a potent inhibitor of the enzyme nitroaldolase (EC 1.2.1.22) and has been shown to inhibit cell growth in murine leukemia cells. This reaction is mediated by the addition of bromide to isobutyl esters, leading to a benzyl ester intermediate which undergoes an electrophilic attack on nitroaldolase. The mechanism of action for this drug involves the inhibition of membrane transport and chloride ion influx, which are necessary for the proliferation of tumor cells. 6-(Bromomethyl)-2,4-pteridinediamine hydrobromide also inhibits DNA synthesis through its effects on thymidylate synthase, preventing nucleotide production from thymine and dihydrofolate reductase activity.
Formula:C7H8Br2N6Purity:Min. 90 Area-%Color and Shape:Yellow PowderMolecular weight:335.99 g/mol6-(Bromomethyl)-2,4-pteridinediamine hydrobromide
CAS:Formula:C7H8Br2N6Purity:90%Color and Shape:SolidMolecular weight:335.9916-(Bromomethyl)-2,4-pteridinediamine Hydrobromide (Technical Grade)
CAS:Controlled ProductFormula:C7H7BrN6·BrHColor and Shape:NeatMolecular weight:335.99




